Difference between revisions of "Tiso gene 17029"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-D-GALACTOSE DTDP-D-GALACTOSE] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RNA-Ligase-L-lysine RNA-Ligase-L-lysine] == * common name: ** an [RNA ligase]-L-lysine * Synony...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-D-GALACTOSE DTDP-D-GALACTOSE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RNA-Ligase-L-lysine RNA-Ligase-L-lysine] ==
* smiles:
+
** CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(CO)C(O)C(O)C(O)2))O3))
+
* inchi key:
+
** InChIKey=YSYKRGRSMLTJNL-OAOVJFGZSA-L
+
 
* common name:
 
* common name:
** dTDP-α-D-galactose
+
** an [RNA ligase]-L-lysine
* molecular weight:
+
** 562.317   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17925]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17926]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[R02984]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an [RNA ligase]-L-lysine}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200820 25200820]
+
{{#set: consumed by=RXN-17925}}
* CHEBI:
+
{{#set: produced by=RXN-17926}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15848 15848]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C02097 C02097]
+
* HMDB : HMDB06876
+
{{#set: smiles=CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(CO)C(O)C(O)C(O)2))O3))}}
+
{{#set: inchi key=InChIKey=YSYKRGRSMLTJNL-OAOVJFGZSA-L}}
+
{{#set: common name=dTDP-α-D-galactose}}
+
{{#set: molecular weight=562.317    }}
+
{{#set: consumed or produced by=R02984}}
+

Revision as of 16:54, 10 January 2018

Metabolite RNA-Ligase-L-lysine

  • common name:
    • an [RNA ligase]-L-lysine
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an [RNA ligase]-L-lysine" cannot be used as a page name in this wiki.