Difference between revisions of "TREHALOSE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-718 CPD-718] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(=O)CCC...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-with-7-aminomethyl-7-deazaguanine tRNA-with-7-aminomethyl-7-deazaguanine] == * common name...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-718 CPD-718] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-with-7-aminomethyl-7-deazaguanine tRNA-with-7-aminomethyl-7-deazaguanine] ==
* smiles:
+
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
* inchi key:
+
** InChIKey=SVBMASFUJDIDJC-XFJIFGBKSA-N
+
 
* common name:
 
* common name:
** 3-dehydroteasterone
+
** a 7-aminomethyl-7-deazaguanosine34 in tRNA
* molecular weight:
+
** 446.669   
+
 
* Synonym(s):
 
* Synonym(s):
** dehydroteasterone
+
** a 7-aminomethyl-7-deazaguanine at position 34 of a tRNA containing GUN anticodon
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN0-1342]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-717]]
+
* [[RXN0-1321]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a 7-aminomethyl-7-deazaguanosine34 in tRNA}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14353979 14353979]
+
{{#set: common name=a 7-aminomethyl-7-deazaguanine at position 34 of a tRNA containing GUN anticodon}}
* CHEBI:
+
{{#set: consumed by=RXN0-1342}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20000 20000]
+
{{#set: produced by=RXN0-1321}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C15792 C15792]
+
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=SVBMASFUJDIDJC-XFJIFGBKSA-N}}
+
{{#set: common name=3-dehydroteasterone}}
+
{{#set: molecular weight=446.669    }}
+
{{#set: common name=dehydroteasterone}}
+
{{#set: produced by=RXN-717}}
+

Revision as of 16:56, 10 January 2018

Metabolite tRNA-with-7-aminomethyl-7-deazaguanine

  • common name:
    • a 7-aminomethyl-7-deazaguanosine34 in tRNA
  • Synonym(s):
    • a 7-aminomethyl-7-deazaguanine at position 34 of a tRNA containing GUN anticodon

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links