Difference between revisions of "Tiso gene 9068"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_10797 == * left end position: ** 2927 * transcription direction: ** POSITIVE * right end position: ** 5964 * centisome position: ** 35.3289...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-718 CPD-718] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(=O)CCC...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_10797 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-718 CPD-718] ==
−
* left end position:
+
* smiles:
−
** 2927
+
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=SVBMASFUJDIDJC-XFJIFGBKSA-N
−
* right end position:
+
* common name:
−
** 5964
+
** 3-dehydroteasterone
−
* centisome position:
+
* molecular weight:
−
** 35.328907    
+
** 446.669    
 
* Synonym(s):
 
* Synonym(s):
 +
** dehydroteasterone
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[GALACTOKIN-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** in-silico_annotation
+
* [[RXN-717]]
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
** experimental_annotation
+
−
***ec-number
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[UDPGLUCEPIM-RXN]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways associated ==
+
−
* [[PWY-7344]]
+
−
* [[PWY-6397]]
+
−
* [[COLANSYN-PWY]]
+
−
* [[PWY-6527]]
+
−
* [[PWY-7328]]
+
−
* [[PWY-6317]]
+
−
* [[PWY66-422]]
+
−
* [[PWY-3821]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=2927}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14353979 14353979]
−
{{#set: right end position=5964}}
+
* CHEBI:
−
{{#set: centisome position=35.328907   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20000 20000]
−
{{#set: reaction associated=GALACTOKIN-RXN|UDPGLUCEPIM-RXN}}
+
* LIGAND-CPD:
−
{{#set: pathway associated=PWY-7344|PWY-6397|COLANSYN-PWY|PWY-6527|PWY-7328|PWY-6317|PWY66-422|PWY-3821}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15792 C15792]
 +
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: inchi key=InChIKey=SVBMASFUJDIDJC-XFJIFGBKSA-N}}
 +
{{#set: common name=3-dehydroteasterone}}
 +
{{#set: molecular weight=446.669   }}
 +
{{#set: common name=dehydroteasterone}}
 +
{{#set: produced by=RXN-717}}

Revision as of 16:56, 10 January 2018

Metabolite CPD-718

  • smiles:
    • CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=SVBMASFUJDIDJC-XFJIFGBKSA-N
  • common name:
    • 3-dehydroteasterone
  • molecular weight:
    • 446.669
  • Synonym(s):
    • dehydroteasterone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_9068&oldid=15360"