Difference between revisions of "RXN-17859"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGTP DGTP] == * smiles: ** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=...")
 
(Created page with "Category:Gene == Gene Tiso_gene_3776 == * left end position: ** 8923 * transcription direction: ** POSITIVE * right end position: ** 10020 * centisome position: ** 55.5396...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGTP DGTP] ==
+
== Gene Tiso_gene_3776 ==
−
* smiles:
+
* left end position:
−
** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
+
** 8923
−
* inchi key:
+
* transcription direction:
−
** InChIKey=HAAZLUGHYHWQIW-KVQBGUIXSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** dGTP
+
** 10020
−
* molecular weight:
+
* centisome position:
−
** 503.152    
+
** 55.53965    
 
* Synonym(s):
 
* Synonym(s):
−
** 2'-deoxyguanosine-5'-triphosphate
 
−
** deoxy-GTP
 
−
** deoxyguanosine-triphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[DGTCY]]
+
* [[3.1.27.9-RXN]]
−
* [[DGTUP]]
+
** in-silico_annotation
−
* [[RXN0-385]]
+
***ec-number
−
* [[RME255]]
+
== Pathways associated ==
−
* [[RXN-11410]]
+
* [[PWY-6689]]
−
* [[RXN-14208]]
+
* [[PWY-7803]]
−
* [[RXN-14217]]
+
−
* [[DGTD]]
+
−
== Reaction(s) known to produce the compound ==
+
−
* [[ATDGD]]
+
−
* [[DGDPKIN-RXN]]
+
−
== Reaction(s) of unknown directionality ==
+
−
* [[RXN-14207]]
+
 
== External links  ==
 
== External links  ==
−
* CAS : 2564-35-4
+
{{#set: left end position=8923}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246112 25246112]
+
{{#set: right end position=10020}}
−
* HMDB : HMDB01440
+
{{#set: centisome position=55.53965   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=3.1.27.9-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00286 C00286]
+
{{#set: pathway associated=PWY-6689|PWY-7803}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61429 61429]
+
−
* BIGG : dgtp
+
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}}
+
−
{{#set: inchi key=InChIKey=HAAZLUGHYHWQIW-KVQBGUIXSA-J}}
+
−
{{#set: common name=dGTP}}
+
−
{{#set: molecular weight=503.152   }}
+
−
{{#set: common name=2'-deoxyguanosine-5'-triphosphate|deoxy-GTP|deoxyguanosine-triphosphate}}
+
−
{{#set: consumed by=DGTCY|DGTUP|RXN0-385|RME255|RXN-11410|RXN-14208|RXN-14217|DGTD}}
+
−
{{#set: produced by=ATDGD|DGDPKIN-RXN}}
+
−
{{#set: consumed or produced by=RXN-14207}}
+

Revision as of 16:57, 10 January 2018

Gene Tiso_gene_3776

  • left end position:
    • 8923
  • transcription direction:
    • POSITIVE
  • right end position:
    • 10020
  • centisome position:
    • 55.53965
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-17859&oldid=15439"