Difference between revisions of "Tiso gene 17022"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MELIBIOSE MELIBIOSE] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OCC2(OC(C(C(C2O)O)O)O)))O * inchi key:...")
 
(Created page with "Category:Gene == Gene Tiso_gene_9739 == * left end position: ** 3701 * transcription direction: ** POSITIVE * right end position: ** 5342 * centisome position: ** 33.33934...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MELIBIOSE MELIBIOSE] ==
+
== Gene Tiso_gene_9739 ==
−
* smiles:
+
* left end position:
−
** C(C1(OC(C(C(C1O)O)O)OCC2(OC(C(C(C2O)O)O)O)))O
+
** 3701
−
* inchi key:
+
* transcription direction:
−
** InChIKey=DLRVVLDZNNYCBX-ZZFZYMBESA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** melibiose
+
** 5342
−
* molecular weight:
+
* centisome position:
−
** 342.299    
+
** 33.33934    
 
* Synonym(s):
 
* Synonym(s):
−
** 6-O-(α-D-galactopyranosyl)-D-glucopyranose
 
−
** D-Gal-α(1->6)-D-glucose
 
−
** D-melibiose
 
−
** 6-O-α-D-galactopyranosyl-D-glucose
 
−
** 6-(α-D-galactosido)-D-glucose
 
−
** α-D-Galp-(1->6)-D-Glc
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[ALPHAGALACTOSID-RXN]]
+
* [[ATCM]]
−
== Reaction(s) known to produce the compound ==
+
** [[pantograph]]-[[creinhardtii]]
−
* [[RFH]]
+
* [[ATCMf]]
−
== Reaction(s) of unknown directionality ==
+
** [[pantograph]]-[[creinhardtii]]
 +
* [[ATDCM]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
* [[ATDCMf]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
* [[RXN-11832]]
 +
** in-silico_annotation
 +
***ec-number
 +
** experimental_annotation
 +
***ec-number
 +
* [[RXN-12002]]
 +
** in-silico_annotation
 +
***ec-number
 +
** experimental_annotation
 +
***ec-number
 +
** [[pantograph]]-[[creinhardtii]]
 +
* [[RXN-7913]]
 +
** in-silico_annotation
 +
***ec-number
 +
** experimental_annotation
 +
***ec-number
 +
* [[UMPKf]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways associated ==
 +
* [[PWY-7205]]
 +
* [[PWY-7197]]
 +
* [[PWY-7176]]
 
== External links  ==
 
== External links  ==
−
* CAS : 585-99-9
+
{{#set: left end position=3701}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11458 11458]
+
{{#set: right end position=5342}}
−
* HMDB : HMDB00048
+
{{#set: centisome position=33.33934   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=ATCM|ATCMf|ATDCM|ATDCMf|RXN-11832|RXN-12002|RXN-7913|UMPKf}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05402 C05402]
+
{{#set: pathway associated=PWY-7205|PWY-7197|PWY-7176}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.10974.html 10974]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61827 61827]
+
−
* BIGG : melib
+
−
{{#set: smiles=C(C1(OC(C(C(C1O)O)O)OCC2(OC(C(C(C2O)O)O)O)))O}}
+
−
{{#set: inchi key=InChIKey=DLRVVLDZNNYCBX-ZZFZYMBESA-N}}
+
−
{{#set: common name=melibiose}}
+
−
{{#set: molecular weight=342.299   }}
+
−
{{#set: common name=6-O-(α-D-galactopyranosyl)-D-glucopyranose|D-Gal-α(1->6)-D-glucose|D-melibiose|6-O-α-D-galactopyranosyl-D-glucose|6-(α-D-galactosido)-D-glucose|α-D-Galp-(1->6)-D-Glc}}
+
−
{{#set: consumed by=ALPHAGALACTOSID-RXN}}
+
−
{{#set: produced by=RFH}}
+

Revision as of 18:02, 10 January 2018

Gene Tiso_gene_9739

  • left end position:
    • 3701
  • transcription direction:
    • POSITIVE
  • right end position:
    • 5342
  • centisome position:
    • 33.33934
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_17022&oldid=15852"