Difference between revisions of "Tiso gene 17022"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MELIBIOSE MELIBIOSE] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OCC2(OC(C(C(C2O)O)O)O)))O * inchi key:...") |
(Created page with "Category:Gene == Gene Tiso_gene_9739 == * left end position: ** 3701 * transcription direction: ** POSITIVE * right end position: ** 5342 * centisome position: ** 33.33934...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_9739 == |
− | * | + | * left end position: |
− | ** | + | ** 3701 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 5342 |
− | * | + | * centisome position: |
− | ** | + | ** 33.33934 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[ATCM]] |
− | + | ** [[pantograph]]-[[creinhardtii]] | |
− | * [[ | + | * [[ATCMf]] |
− | == | + | ** [[pantograph]]-[[creinhardtii]] |
+ | * [[ATDCM]] | ||
+ | ** [[pantograph]]-[[creinhardtii]] | ||
+ | * [[ATDCMf]] | ||
+ | ** [[pantograph]]-[[creinhardtii]] | ||
+ | * [[RXN-11832]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-12002]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[creinhardtii]] | ||
+ | * [[RXN-7913]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | * [[UMPKf]] | ||
+ | ** [[pantograph]]-[[creinhardtii]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7205]] | ||
+ | * [[PWY-7197]] | ||
+ | * [[PWY-7176]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3701}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=5342}} | |
− | + | {{#set: centisome position=33.33934 }} | |
− | + | {{#set: reaction associated=ATCM|ATCMf|ATDCM|ATDCMf|RXN-11832|RXN-12002|RXN-7913|UMPKf}} | |
− | + | {{#set: pathway associated=PWY-7205|PWY-7197|PWY-7176}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 18:02, 10 January 2018
Gene Tiso_gene_9739
- left end position:
- 3701
- transcription direction:
- POSITIVE
- right end position:
- 5342
- centisome position:
- 33.33934
- Synonym(s):
Reactions associated
- ATCM
- ATCMf
- ATDCM
- ATDCMf
- RXN-11832
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- in-silico_annotation
- RXN-12002
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- pantograph-creinhardtii
- in-silico_annotation
- RXN-7913
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- in-silico_annotation
- UMPKf