Difference between revisions of "CYS-tRNAs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10411 CPD-10411] == * smiles: ** C1(C(O)=C(O)C(O)=CC=1C2(OC3(C(CC(O)2)=C(O)C=C(O)C=3))) * i...") |
(Created page with "Category:Gene == Gene Tiso_gene_2719 == * left end position: ** 6919 * transcription direction: ** NEGATIVE * right end position: ** 11220 * centisome position: ** 37.3495...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_2719 == |
− | * | + | * left end position: |
− | ** | + | ** 6919 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 11220 |
− | * | + | * centisome position: |
− | ** | + | ** 37.34953 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[3.2.1.113-RXN]] | |
− | * [[RXN- | + | ** in-silico_annotation |
− | == | + | ***ec-number |
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=6919}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=11220}} | |
− | + | {{#set: centisome position=37.34953 }} | |
− | + | {{#set: reaction associated=3.2.1.113-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 17:09, 10 January 2018
Gene Tiso_gene_2719
- left end position:
- 6919
- transcription direction:
- NEGATIVE
- right end position:
- 11220
- centisome position:
- 37.34953
- Synonym(s):
Reactions associated
- 3.2.1.113-RXN
- in-silico_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation