Difference between revisions of "RXN1G-509"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11740 CPD-11740] == * smiles: ** C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-] * inchi key: ** InCh...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10411 CPD-10411] == * smiles: ** C1(C(O)=C(O)C(O)=CC=1C2(OC3(C(CC(O)2)=C(O)C=C(O)C=3))) * i...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10411 CPD-10411] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C1(C(O)=C(O)C(O)=CC=1C2(OC3(C(CC(O)2)=C(O)C=C(O)C=3))) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=XMOCLSLCDHWDHP-IUODEOHRSA-N |
* common name: | * common name: | ||
| − | ** | + | ** (-)-epigallocatechin |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 306.271 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 2,3-cis-epigallocatechin | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-9723]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * LIPID_MAPS : LMPK12020004 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72277 72277] |
| − | {{#set: smiles= | + | * HMDB : HMDB38361 |
| − | {{#set: inchi key=InChIKey= | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C12136 C12136] |
| − | {{#set: molecular weight= | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.65231.html 65231] |
| − | {{#set: produced by=RXN- | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=42255 42255] | ||
| + | * METABOLIGHTS : MTBLC42255 | ||
| + | {{#set: smiles=C1(C(O)=C(O)C(O)=CC=1C2(OC3(C(CC(O)2)=C(O)C=C(O)C=3)))}} | ||
| + | {{#set: inchi key=InChIKey=XMOCLSLCDHWDHP-IUODEOHRSA-N}} | ||
| + | {{#set: common name=(-)-epigallocatechin}} | ||
| + | {{#set: molecular weight=306.271 }} | ||
| + | {{#set: common name=2,3-cis-epigallocatechin}} | ||
| + | {{#set: produced by=RXN-9723}} | ||
Revision as of 17:10, 10 January 2018
Contents
Metabolite CPD-10411
- smiles:
- C1(C(O)=C(O)C(O)=CC=1C2(OC3(C(CC(O)2)=C(O)C=C(O)C=3)))
- inchi key:
- InChIKey=XMOCLSLCDHWDHP-IUODEOHRSA-N
- common name:
- (-)-epigallocatechin
- molecular weight:
- 306.271
- Synonym(s):
- 2,3-cis-epigallocatechin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- LIPID_MAPS : LMPK12020004
- PUBCHEM:
- HMDB : HMDB38361
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC42255
