Difference between revisions of "Tiso gene 11263"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.91-RXN 2.3.1.91-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.o...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-29 CPDQT-29] == * smiles: ** CSCCCCCCC(=O)C([O-])=O * inchi key: ** InChIKey=QDZNKMGEHAHO...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-29 CPDQT-29] == |
− | * | + | * smiles: |
− | ** | + | ** CSCCCCCCC(=O)C([O-])=O |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=QDZNKMGEHAHOTA-UHFFFAOYSA-M |
+ | * common name: | ||
+ | ** 8-(methylthio)-2-oxooctanoate | ||
+ | * molecular weight: | ||
+ | ** 203.276 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 8-(methylthio)-2-oxooctanoic acid | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-18205]] | |
− | + | * [[RXNQT-4171]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237313 44237313] |
− | * | + | * KNAPSACK : C00007643 |
− | + | {{#set: smiles=CSCCCCCCC(=O)C([O-])=O}} | |
− | {{#set: | + | {{#set: inchi key=InChIKey=QDZNKMGEHAHOTA-UHFFFAOYSA-M}} |
− | {{#set: | + | {{#set: common name=8-(methylthio)-2-oxooctanoate}} |
− | {{#set: | + | {{#set: molecular weight=203.276 }} |
− | + | {{#set: common name=8-(methylthio)-2-oxooctanoic acid}} | |
− | {{#set: | + | {{#set: produced by=RXN-18205|RXNQT-4171}} |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 18:10, 10 January 2018
Contents
Metabolite CPDQT-29
- smiles:
- CSCCCCCCC(=O)C([O-])=O
- inchi key:
- InChIKey=QDZNKMGEHAHOTA-UHFFFAOYSA-M
- common name:
- 8-(methylthio)-2-oxooctanoate
- molecular weight:
- 203.276
- Synonym(s):
- 8-(methylthio)-2-oxooctanoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- KNAPSACK : C00007643
"CSCCCCCCC(=O)C([O-])=O" cannot be used as a page name in this wiki.