Difference between revisions of "GLUCONATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUCONATE GLUCONATE] == * smiles: ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InChIKey=RGH...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13575 CPD-13575] == * smiles: ** CC1(C(=CCOP([O-])(=O)[O-])SC(C(=O)[O-])N=1) * inchi key: *...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13575 CPD-13575] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC1(C(=CCOP([O-])(=O)[O-])SC(C(=O)[O-])N=1) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=PQMCQNOVNFNPFJ-HYIMLASBSA-K |
* common name: | * common name: | ||
| − | ** | + | ** 2-[(2R,5Z)-2-carboxy-4-methylthiazol-5(2H)-ylidene]ethyl phosphate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 264.169 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** cThz*-P |
| − | ** | + | ** thiazole tautomer |
| − | ** | + | ** (R,Z)-2-(2-carboxy-4-methylthiazol-5(2H)-ylidene)ethyl phosphate |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-12611]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53477654 53477654] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62899 62899] |
| − | + | {{#set: smiles=CC1(C(=CCOP([O-])(=O)[O-])SC(C(=O)[O-])N=1)}} | |
| − | {{#set: smiles= | + | {{#set: inchi key=InChIKey=PQMCQNOVNFNPFJ-HYIMLASBSA-K}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: common name=2-[(2R,5Z)-2-carboxy-4-methylthiazol-5(2H)-ylidene]ethyl phosphate}} |
| − | {{#set: common name= | + | {{#set: molecular weight=264.169 }} |
| − | {{#set: molecular weight= | + | {{#set: common name=cThz*-P|thiazole tautomer|(R,Z)-2-(2-carboxy-4-methylthiazol-5(2H)-ylidene)ethyl phosphate}} |
| − | {{#set: common name= | + | {{#set: consumed by=RXN-12611}} |
| − | {{#set: | + | |
Revision as of 17:12, 10 January 2018
Contents
Metabolite CPD-13575
- smiles:
- CC1(C(=CCOP([O-])(=O)[O-])SC(C(=O)[O-])N=1)
- inchi key:
- InChIKey=PQMCQNOVNFNPFJ-HYIMLASBSA-K
- common name:
- 2-[(2R,5Z)-2-carboxy-4-methylthiazol-5(2H)-ylidene]ethyl phosphate
- molecular weight:
- 264.169
- Synonym(s):
- cThz*-P
- thiazole tautomer
- (R,Z)-2-(2-carboxy-4-methylthiazol-5(2H)-ylidene)ethyl phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(C(=CCOP([O-])(=O)[O-])SC(C(=O)[O-])N=1)" cannot be used as a page name in this wiki.
"2-[(2R,5Z)-2-carboxy-4-methylthiazol-5(2H)-ylidene]ethyl phosphate" cannot be used as a page name in this wiki.
