Difference between revisions of "1-KETO-2-METHYLVALERATE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_4139 == * left end position: ** 2802 * transcription direction: ** POSITIVE * right end position: ** 3987 * centisome position: ** 18.22676...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETO-ADIPATE 3-KETO-ADIPATE] == * smiles: ** C(=O)([O-])CC(=O)CCC(=O)[O-] * inchi key: ** InC...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETO-ADIPATE 3-KETO-ADIPATE] == |
− | * | + | * smiles: |
− | ** | + | ** C(=O)([O-])CC(=O)CCC(=O)[O-] |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=RTGHRDFWYQHVFW-UHFFFAOYSA-L |
− | * | + | * common name: |
− | ** | + | ** 3-oxoadipate |
− | * | + | * molecular weight: |
− | ** | + | ** 158.11 |
* Synonym(s): | * Synonym(s): | ||
+ | ** β-ketoadipate | ||
+ | ** 3-ketoadipate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[3-OXOADIPATE-ENOL-LACTONASE-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * UM-BBD-CPD : c0100 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459800 5459800] |
− | {{#set: | + | * HMDB : HMDB00398 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00846 C00846] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4573571.html 4573571] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15775 15775] | ||
+ | {{#set: smiles=C(=O)([O-])CC(=O)CCC(=O)[O-]}} | ||
+ | {{#set: inchi key=InChIKey=RTGHRDFWYQHVFW-UHFFFAOYSA-L}} | ||
+ | {{#set: common name=3-oxoadipate}} | ||
+ | {{#set: molecular weight=158.11 }} | ||
+ | {{#set: common name=β-ketoadipate|3-ketoadipate}} | ||
+ | {{#set: produced by=3-OXOADIPATE-ENOL-LACTONASE-RXN}} |
Revision as of 18:21, 10 January 2018
Contents
Metabolite 3-KETO-ADIPATE
- smiles:
- C(=O)([O-])CC(=O)CCC(=O)[O-]
- inchi key:
- InChIKey=RTGHRDFWYQHVFW-UHFFFAOYSA-L
- common name:
- 3-oxoadipate
- molecular weight:
- 158.11
- Synonym(s):
- β-ketoadipate
- 3-ketoadipate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- UM-BBD-CPD : c0100
- PUBCHEM:
- HMDB : HMDB00398
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
"C(=O)([O-])CC(=O)CCC(=O)[O-" cannot be used as a page name in this wiki.