Difference between revisions of "Cis-cis-D7-25-3-hydroxyC44-2-ACPs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-611 CPD-611] == * smiles: ** CC1([N+](=CSC(CCOP([O-])(=O)OP([O-])(=O)OP([O-])(=O)[O-])=1)CC...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10813 CPD-10813] == * smiles: ** C(C(CC1(=CC=C(C(=C1)I)OC2(=CC(=C(C(I)=C2)O)I)))[N+])([O-])...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10813 CPD-10813] == |
* smiles: | * smiles: | ||
− | ** CC1 | + | ** C(C(CC1(=CC=C(C(=C1)I)OC2(=CC(=C(C(I)=C2)O)I)))[N+])([O-])=O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=HZCBWYNLGPIQRK-LBPRGKRZSA-N |
* common name: | * common name: | ||
− | ** | + | ** 3,3',5'-triiodo-L-thyronine |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 650.978 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** reverse triiodothyronine |
+ | ** rT3 | ||
+ | ** triiodothyronine, reverse | ||
+ | ** 4-(4-hydroxy-3,5-diiodophenoxy)-3-iodophenylalanine | ||
+ | ** O-(4-hydroxy-3,5-diiodophenyl)-3-iodotyrosine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-10604]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123465 44123465] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57261 57261] |
− | * METABOLIGHTS : | + | * METABOLIGHTS : MTBLC57261 |
− | {{#set: smiles= | + | * LIGAND-CPD: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C07639 C07639] |
− | {{#set: common name= | + | {{#set: smiles=C(C(CC1(=CC=C(C(=C1)I)OC2(=CC(=C(C(I)=C2)O)I)))[N+])([O-])=O}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=HZCBWYNLGPIQRK-LBPRGKRZSA-N}} |
− | {{#set: common name= | + | {{#set: common name=3,3',5'-triiodo-L-thyronine}} |
− | + | {{#set: molecular weight=650.978 }} | |
− | {{#set: | + | {{#set: common name=reverse triiodothyronine|rT3|triiodothyronine, reverse|4-(4-hydroxy-3,5-diiodophenoxy)-3-iodophenylalanine|O-(4-hydroxy-3,5-diiodophenyl)-3-iodotyrosine}} |
+ | {{#set: consumed by=RXN-10604}} |
Revision as of 17:25, 10 January 2018
Contents
Metabolite CPD-10813
- smiles:
- C(C(CC1(=CC=C(C(=C1)I)OC2(=CC(=C(C(I)=C2)O)I)))[N+])([O-])=O
- inchi key:
- InChIKey=HZCBWYNLGPIQRK-LBPRGKRZSA-N
- common name:
- 3,3',5'-triiodo-L-thyronine
- molecular weight:
- 650.978
- Synonym(s):
- reverse triiodothyronine
- rT3
- triiodothyronine, reverse
- 4-(4-hydroxy-3,5-diiodophenoxy)-3-iodophenylalanine
- O-(4-hydroxy-3,5-diiodophenyl)-3-iodotyrosine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(CC1(=CC=C(C(=C1)I)OC2(=CC(=C(C(I)=C2)O)I)))[N+])([O-])=O" cannot be used as a page name in this wiki.