Difference between revisions of "Tiso gene 599"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13757 CPD-13757] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(C(O)CCC2(C)(C(=O)C...")
 
(Created page with "Category:Gene == Gene Tiso_gene_6404 == * left end position: ** 656 * transcription direction: ** NEGATIVE * right end position: ** 12245 * centisome position: ** 5.355976...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13757 CPD-13757] ==
+
== Gene Tiso_gene_6404 ==
−
* smiles:
+
* left end position:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(C(O)CCC2(C)(C(=O)CC[CH]12)))COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-]
+
** 656
−
* inchi key:
+
* transcription direction:
−
** InChIKey=GXYIOJONRQGUCV-SWBALSFASA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 3-[(3aS,4S,5R,7aS)-5-hydroxy-7a-methyl-1-oxo-octahydro-1H-inden-4-yl]-3-hydroxypropanoyl-CoA
+
** 12245
−
* molecular weight:
+
* centisome position:
−
** 1001.785    
+
** 5.3559766    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-12750]]
+
* [[ADENYLATECYC-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=656}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657574 90657574]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(C(O)CCC2(C)(C(=O)CC[CH]12)))COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-]}}
+
{{#set: right end position=12245}}
−
{{#set: inchi key=InChIKey=GXYIOJONRQGUCV-SWBALSFASA-J}}
+
{{#set: centisome position=5.3559766   }}
−
{{#set: common name=3-[(3aS,4S,5R,7aS)-5-hydroxy-7a-methyl-1-oxo-octahydro-1H-inden-4-yl]-3-hydroxypropanoyl-CoA}}
+
{{#set: reaction associated=ADENYLATECYC-RXN}}
−
{{#set: molecular weight=1001.785   }}
+
−
{{#set: consumed by=RXN-12750}}
+

Revision as of 17:26, 10 January 2018

Gene Tiso_gene_6404

  • left end position:
    • 656
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 12245
  • centisome position:
    • 5.3559766
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_599&oldid=17771"