Difference between revisions of "Tiso gene 570"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-90 CPD1F-90] == * smiles: ** C3(C=C(O)C=CC(C1(=C([O-])C(=O)C2(C(O)=CC(O)=CC(O1)=2)))=3) *...") |
(Created page with "Category:Gene == Gene Tiso_gene_14025 == * left end position: ** 245 * transcription direction: ** POSITIVE * right end position: ** 1272 * centisome position: ** 4.158180...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_14025 == |
− | * | + | * left end position: |
− | ** | + | ** 245 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 1272 |
− | * | + | * centisome position: |
− | ** | + | ** 4.1581807 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[RXN | + | * [[DNA-DIRECTED-RNA-POLYMERASE-RXN]] |
− | * | + | ** in-silico_annotation |
− | + | ***automated-name-match | |
− | * | + | == Pathways associated == |
− | == | + | |
== External links == | == External links == | ||
− | + | {{#set: left end position=245}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=1272}} | |
− | + | {{#set: centisome position=4.1581807 }} | |
− | + | {{#set: reaction associated=DNA-DIRECTED-RNA-POLYMERASE-RXN}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 17:27, 10 January 2018
Gene Tiso_gene_14025
- left end position:
- 245
- transcription direction:
- POSITIVE
- right end position:
- 1272
- centisome position:
- 4.1581807
- Synonym(s):
Reactions associated
- DNA-DIRECTED-RNA-POLYMERASE-RXN
- in-silico_annotation
- automated-name-match
- in-silico_annotation