Difference between revisions of "RXN66-162"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13378 CPD-13378] == * smiles: ** C9(C(C(C(C(OCC8(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15910 RXN-15910] == * direction: ** LEFT-TO-RIGHT * common name: ** alpha-glucosidase * ec numb...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13378 CPD-13378] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15910 RXN-15910] ==
* smiles:
+
* direction:
** C9(C(C(C(C(OCC8(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC6(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)OC5(C(C(C(C(O5)CO)O)O)O)))6)OC7(C(O)C(O)C(O)OC(CO)7))))C(O)C(O)C(O)8))O9)O)O)O)
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=GSCHIGXDTVYEEM-MIGIYTHBSA-N
+
 
* common name:
 
* common name:
** XLLG xyloglucan oligosaccharide
+
** alpha-glucosidase
* molecular weight:
+
* ec number:
** 1387.215   
+
** [http://enzyme.expasy.org/EC/3.2.1.20 EC-3.2.1.20]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-12400]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[WATER]][c] '''+''' 1 [[MALTOSE]][c] '''=>''' 2 [[Glucopyranose]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H2O[c] '''+''' 1 maltose[c] '''=>''' 2 D-glucopyranose[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_2588]]
 +
** [[pantograph]]-[[athaliana]]
 +
** [[pantograph]]-[[athaliana]]
 +
* [[Tiso_gene_600]]
 +
** IN-SILICO_ANNOTATION
 +
***AUTOMATED-NAME-MATCH
 +
* [[Tiso_gene_599]]
 +
** IN-SILICO_ANNOTATION
 +
***AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-842]], starch degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-842 PWY-842]
 +
** '''1''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[athaliana]]
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[in-silico_annotation]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* LIGAND-RXN:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940189 52940189]
+
** [http://www.genome.jp/dbget-bin/www_bget?R00028 R00028]
{{#set: smiles=C9(C(C(C(C(OCC8(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC6(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)OC5(C(C(C(C(O5)CO)O)O)O)))6)OC7(C(O)C(O)C(O)OC(CO)7))))C(O)C(O)C(O)8))O9)O)O)O)}}
+
{{#set: direction=LEFT-TO-RIGHT}}
{{#set: inchi key=InChIKey=GSCHIGXDTVYEEM-MIGIYTHBSA-N}}
+
{{#set: common name=alpha-glucosidase}}
{{#set: common name=XLLG xyloglucan oligosaccharide}}
+
{{#set: ec number=EC-3.2.1.20}}
{{#set: molecular weight=1387.215    }}
+
{{#set: gene associated=Tiso_gene_2588|Tiso_gene_600|Tiso_gene_599}}
{{#set: consumed by=RXN-12400}}
+
{{#set: in pathway=PWY-842}}
 +
{{#set: reconstruction category=orthology}}
 +
{{#set: reconstruction tool=pantograph}}
 +
{{#set: reconstruction source=athaliana}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}
 +
{{#set: reconstruction source=in-silico_annotation}}

Revision as of 17:29, 10 January 2018

Reaction RXN-15910

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • alpha-glucosidase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H2O[c] + 1 maltose[c] => 2 D-glucopyranose[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-842, starch degradation I: PWY-842
    • 1 reactions found over 3 reactions in the full pathway

Reconstruction information

External links