Difference between revisions of "RXN-11135"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_18743 == * left end position: ** 423 * transcription direction: ** NEGATIVE * right end position: ** 2567 * centisome position: ** 14.99468...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14604 CPD-14604] == * smiles: ** CC(CCC([O-])=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(OC1(C(O)C(C(O)...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14604 CPD-14604] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(CCC([O-])=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))2)3))OC) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=BYFGTSAYQQIUCN-HGIHDBQLSA-L |
| − | * | + | * common name: |
| − | ** | + | ** mycophenolic acid phenolic glucuronide |
| − | * | + | * molecular weight: |
| − | ** | + | ** 494.451 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-13608]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657160 90657160] |
| − | {{#set: | + | {{#set: smiles=CC(CCC([O-])=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))2)3))OC)}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=BYFGTSAYQQIUCN-HGIHDBQLSA-L}} |
| − | {{#set: | + | {{#set: common name=mycophenolic acid phenolic glucuronide}} |
| − | {{#set: | + | {{#set: molecular weight=494.451 }} |
| + | {{#set: produced by=RXN-13608}} | ||
Revision as of 17:33, 10 January 2018
Contents
Metabolite CPD-14604
- smiles:
- CC(CCC([O-])=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))2)3))OC)
- inchi key:
- InChIKey=BYFGTSAYQQIUCN-HGIHDBQLSA-L
- common name:
- mycophenolic acid phenolic glucuronide
- molecular weight:
- 494.451
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(CCC([O-])=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))2)3))OC)" cannot be used as a page name in this wiki.
