Difference between revisions of "Tiso gene 646"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17729 RXN-17729] == * direction: ** LEFT-TO-RIGHT * common name: ** 1-acylglycerol-3-phosphate_...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14596 CPD-14596] == * smiles: ** CCC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17729 RXN-17729] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14596 CPD-14596] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C
 +
* inchi key:
 +
** InChIKey=WOSYVGNDRYBQCQ-BARGLTKPSA-N
 
* common name:
 
* common name:
−
** 1-acylglycerol-3-phosphate_o-acyltransferase
+
** neolinustatin
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.3.1.51 EC-2.3.1.51]
+
** 423.416   
 
* Synonym(s):
 
* Synonym(s):
 +
** butanenitrile
 +
** [(2R)-2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylbutyronitrile)]
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-13603]]
−
** 1 [[Long-Chain-Acyl-CoAs]][c] '''+''' 1 [[1-Alkyl-glycerol-3-phosphate]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[1-Alkyl-2-acyl-glycerol-3-phosphate]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a long-chain acyl-CoA[c] '''+''' 1 a 1-alkyl-sn-glycerol 3-phosphate[c] '''=>''' 1 coenzyme A[c] '''+''' 1 a 2-acyl-1-alkyl-sn-glycerol 3-phosphate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_13959]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
** EXPERIMENTAL_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-7782]], plasmalogen biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7782 PWY-7782]
+
−
** '''7''' reactions found over '''16''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIGAND-CPD:
−
{{#set: common name=1-acylglycerol-3-phosphate_o-acyltransferase}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C08336 C08336]
−
{{#set: ec number=EC-2.3.1.51}}
+
* CHEBI:
−
{{#set: gene associated=Tiso_gene_13959}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=7506 7506]
−
{{#set: in pathway=PWY-7782}}
+
* PUBCHEM:
−
{{#set: reconstruction category=annotation}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=119533 119533]
−
{{#set: reconstruction tool=pathwaytools}}
+
* HMDB : HMDB38482
−
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+
{{#set: smiles=CCC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C}}
 +
{{#set: inchi key=InChIKey=WOSYVGNDRYBQCQ-BARGLTKPSA-N}}
 +
{{#set: common name=neolinustatin}}
 +
{{#set: molecular weight=423.416    }}
 +
{{#set: common name=butanenitrile|[(2R)-2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylbutyronitrile)]}}
 +
{{#set: consumed by=RXN-13603}}

Revision as of 17:35, 10 January 2018

Metabolite CPD-14596

  • smiles:
    • CCC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C
  • inchi key:
    • InChIKey=WOSYVGNDRYBQCQ-BARGLTKPSA-N
  • common name:
    • neolinustatin
  • molecular weight:
    • 423.416
  • Synonym(s):
    • butanenitrile
    • [(2R)-2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylbutyronitrile)]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_646&oldid=18517"