Difference between revisions of "NONAPRENYL-4-HYDROXYBENZOATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14877 CPD-14877] == * smiles: ** CC(=O)NC1(=CC(C([O-])=O)=CC=C(O)1) * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene Tiso_gene_15498 == * left end position: ** 983 * transcription direction: ** POSITIVE * right end position: ** 2829 * centisome position: ** 19.67968...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_15498 == |
− | * | + | * left end position: |
− | ** | + | ** 983 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2829 |
− | * | + | * centisome position: |
− | ** | + | ** 19.67968 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[4-NITROPHENYLPHOSPHATASE-RXN]] | |
− | == | + | ** in-silico_annotation |
− | * [[ | + | ***ec-number |
+ | * [[GPH-RXN]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-181]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=983}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | {{#set: | + | {{#set: right end position=2829}} |
− | {{#set: | + | {{#set: centisome position=19.67968 }} |
− | {{#set: | + | {{#set: reaction associated=4-NITROPHENYLPHOSPHATASE-RXN|GPH-RXN}} |
− | {{#set: | + | {{#set: pathway associated=PWY-181}} |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 18:01, 18 March 2018
Gene Tiso_gene_15498
- left end position:
- 983
- transcription direction:
- POSITIVE
- right end position:
- 2829
- centisome position:
- 19.67968
- Synonym(s):
Reactions associated
- 4-NITROPHENYLPHOSPHATASE-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
- GPH-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation