Difference between revisions of "BIOPTERIN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17638 CPD-17638] == * smiles: ** CCCCCC(O)CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
(Created page with "Category:Gene == Gene Tiso_gene_9453 == * left end position: ** 1044 * transcription direction: ** POSITIVE * right end position: ** 5927 * centisome position: ** 11.17773...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17638 CPD-17638] ==
+
== Gene Tiso_gene_9453 ==
* smiles:
+
* left end position:
** CCCCCC(O)CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 1044
* inchi key:
+
* transcription direction:
** InChIKey=RXEDUSGPUQQZEW-XIRPNGCASA-J
+
** POSITIVE
* common name:
+
* right end position:
** 7-hydroxylauroyl-CoA
+
** 5927
* molecular weight:
+
* centisome position:
** 961.807    
+
** 11.177730    
 
* Synonym(s):
 
* Synonym(s):
** 7-hydroxydodecanoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* [[3.1.26.4-RXN]]
* [[RXN-12184]]
+
** in-silico_annotation
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=1044}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819849 91819849]
+
{{#set: transcription direction=POSITIVE}}
{{#set: smiles=CCCCCC(O)CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: right end position=5927}}
{{#set: inchi key=InChIKey=RXEDUSGPUQQZEW-XIRPNGCASA-J}}
+
{{#set: centisome position=11.177730   }}
{{#set: common name=7-hydroxylauroyl-CoA}}
+
{{#set: reaction associated=3.1.26.4-RXN}}
{{#set: molecular weight=961.807   }}
+
{{#set: common name=7-hydroxydodecanoyl-CoA}}
+
{{#set: produced by=RXN-12184}}
+

Revision as of 18:02, 18 March 2018

Gene Tiso_gene_9453

  • left end position:
    • 1044
  • transcription direction:
    • POSITIVE
  • right end position:
    • 5927
  • centisome position:
    • 11.177730
  • Synonym(s):

Reactions associated

Pathways associated

External links