Difference between revisions of "PWY-7442"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11495 CPD-11495] == * smiles: ** C(=O)([O-])CC1(=CC=CC=C(O)1) * inchi key: ** InChIKey=CCVY...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Leader-Sequences Leader-Sequences] == * common name: ** a leader sequence * Synonym(s): == Rea...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11495 CPD-11495] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Leader-Sequences Leader-Sequences] ==
* smiles:
+
** C(=O)([O-])CC1(=CC=CC=C(O)1)
+
* inchi key:
+
** InChIKey=CCVYRRGZDBSHFU-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** 2-hydroxyphenylacetate
+
** a leader sequence
* molecular weight:
+
** 151.141   
+
 
* Synonym(s):
 
* Synonym(s):
** 2-hydroxyphenylacetic acid
 
** benzeneacetic acid, 2-hydroxy-
 
** 2-hydroxybenzeneacetic acid
 
** acetic acid, (o-hydroxyphenyl)-
 
** o-hydroxy phenylacetic acid
 
** o-hydroxyphenylacetate
 
** o-hydroxyphenylacetic acid
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10815]]
+
* [[3.4.21.89-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a leader sequence}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6933325 6933325]
+
{{#set: produced by=3.4.21.89-RXN}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.5307390.html 5307390]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62423 62423]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C05852 C05852]
+
* HMDB : HMDB00669
+
{{#set: smiles=C(=O)([O-])CC1(=CC=CC=C(O)1)}}
+
{{#set: inchi key=InChIKey=CCVYRRGZDBSHFU-UHFFFAOYSA-M}}
+
{{#set: common name=2-hydroxyphenylacetate}}
+
{{#set: molecular weight=151.141    }}
+
{{#set: common name=2-hydroxyphenylacetic acid|benzeneacetic acid, 2-hydroxy-|2-hydroxybenzeneacetic acid|acetic acid, (o-hydroxyphenyl)-|o-hydroxy phenylacetic acid|o-hydroxyphenylacetate|o-hydroxyphenylacetic acid}}
+
{{#set: produced by=RXN-10815}}
+

Revision as of 18:02, 18 March 2018

Metabolite Leader-Sequences

  • common name:
    • a leader sequence
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links