Difference between revisions of "Tiso gene 8889"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MONO-VINYL-PROTOCHLOROPHYLLIDE-A MONO-VINYL-PROTOCHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C...")
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6802 PWY-6802] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MONO-VINYL-PROTOCHLOROPHYLLIDE-A MONO-VINYL-PROTOCHLOROPHYLLIDE-A] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
** C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
 
* common name:
 
* common name:
−
** salidroside biosynthesis
+
** protochlorophyllide a
 +
* molecular weight:
 +
** 610.951   
 
* Synonym(s):
 
* Synonym(s):
 +
** monovinyl protochlorophyllide a
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''3''' reactions found over '''4''' reactions in the full pathway
+
* [[R03845]]
−
* [[RXN-5821]]
+
== Reaction(s) known to produce the compound ==
−
* [[RXN3O-4113]]
+
== Reaction(s) of unknown directionality ==
−
* [[TYROSINE-DECARBOXYLASE-RXN]]
+
* [[RXN1F-10]]
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12370 RXN-12370]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-33090}}
+
* CAS : 14751-08-7
−
{{#set: common name=salidroside biosynthesis}}
+
* PUBCHEM:
−
{{#set: reaction found=3}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54749448 54749448]
−
{{#set: reaction not found=4}}
+
* CHEBI:
−
{{#set: completion rate=75.0}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57855 57855]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C02880 C02880]
 +
* HMDB : HMDB31148
 +
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
 +
{{#set: common name=protochlorophyllide a}}
 +
{{#set: molecular weight=610.951    }}
 +
{{#set: common name=monovinyl protochlorophyllide a}}
 +
{{#set: consumed by=R03845}}
 +
{{#set: reversible reaction associated=RXN1F-10}}

Revision as of 18:04, 18 March 2018

Metabolite MONO-VINYL-PROTOCHLOROPHYLLIDE-A

  • smiles:
    • C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
  • common name:
    • protochlorophyllide a
  • molecular weight:
    • 610.951
  • Synonym(s):
    • monovinyl protochlorophyllide a

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_8889&oldid=21753"