Difference between revisions of "Tiso gene 15852"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15348 RXN-15348] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-28 CPDQT-28] == * smiles: ** CSCCCCCC(=O)C([O-])=O * inchi key: ** InChIKey=TWAIOPPFLZEXC...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15348 RXN-15348] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-28 CPDQT-28] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CSCCCCCC(=O)C([O-])=O
 +
* inchi key:
 +
** InChIKey=TWAIOPPFLZEXCO-UHFFFAOYSA-M
 +
* common name:
 +
** 7-(methylthio)-2-oxoheptanoate
 +
* molecular weight:
 +
** 189.249   
 
* Synonym(s):
 
* Synonym(s):
 +
** 7-(methylthio)-2-oxoheptanoic acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[OXIDIZED-GLUTATHIONE]][c] '''+''' 1 [[HS]][c] '''=>''' 1 [[GLUTATHIONE]][c] '''+''' 1 [[CPD-11281]][c]
+
* [[RXNQT-4168]]
−
* With common name(s):
+
* [[RXN-18207]]
−
** 1 glutathione disulfide[c] '''+''' 1 hydrogen sulfide[c] '''=>''' 1 glutathione[c] '''+''' 1 S-sulfanylglutathione[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-5285]], sulfide oxidation III (persulfide dioxygenase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5285 PWY-5285]
+
−
** '''1''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: in pathway=PWY-5285}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237184 44237184]
−
{{#set: reconstruction category=annotation}}
+
* KNAPSACK : C00007645
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: smiles=CSCCCCCC(=O)C([O-])=O}}
−
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+
{{#set: inchi key=InChIKey=TWAIOPPFLZEXCO-UHFFFAOYSA-M}}
 +
{{#set: common name=7-(methylthio)-2-oxoheptanoate}}
 +
{{#set: molecular weight=189.249    }}
 +
{{#set: common name=7-(methylthio)-2-oxoheptanoic acid}}
 +
{{#set: produced by=RXNQT-4168|RXN-18207}}

Revision as of 18:08, 18 March 2018

Metabolite CPDQT-28

  • smiles:
    • CSCCCCCC(=O)C([O-])=O
  • inchi key:
    • InChIKey=TWAIOPPFLZEXCO-UHFFFAOYSA-M
  • common name:
    • 7-(methylthio)-2-oxoheptanoate
  • molecular weight:
    • 189.249
  • Synonym(s):
    • 7-(methylthio)-2-oxoheptanoic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • PUBCHEM:
  • KNAPSACK : C00007645
"CSCCCCCC(=O)C([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_15852&oldid=22248"