Difference between revisions of "Tiso gene 18421"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_6754 == * Synonym(s): == Reactions associated == * 3-OXOACID-COA-TRANSFERASE-RXN ** in-silico_annotation ***ec-number ** experimental_...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2500 CPD0-2500] == * smiles: ** C(O)C2(C(O)C(O)C(O)C(OC1(C=CC(=CC=1)[N+]([O-])=O))O2) * in...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2500 CPD0-2500] == |
| + | * smiles: | ||
| + | ** C(O)C2(C(O)C(O)C(O)C(OC1(C=CC(=CC=1)[N+]([O-])=O))O2) | ||
| + | * inchi key: | ||
| + | ** InChIKey=IFBHRQDFSNCLOZ-IIRVCBMXSA-N | ||
| + | * common name: | ||
| + | ** p-nitrophenyl-α-D-galactopyranoside | ||
| + | * molecular weight: | ||
| + | ** 301.252 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 4-nitrophenyl-α-D-galactopyranoside | ||
| + | ** 4-nitrophenyl-α-D-galactoside | ||
| + | ** p-nitrophenyl-α-D-galactoside | ||
| + | ** pNPαGal | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-17830]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=82000 82000] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=546840 546840] | ||
| + | {{#set: smiles=C(O)C2(C(O)C(O)C(O)C(OC1(C=CC(=CC=1)[N+]([O-])=O))O2)}} | ||
| + | {{#set: inchi key=InChIKey=IFBHRQDFSNCLOZ-IIRVCBMXSA-N}} | ||
| + | {{#set: common name=p-nitrophenyl-α-D-galactopyranoside}} | ||
| + | {{#set: molecular weight=301.252 }} | ||
| + | {{#set: common name=4-nitrophenyl-α-D-galactopyranoside|4-nitrophenyl-α-D-galactoside|p-nitrophenyl-α-D-galactoside|pNPαGal}} | ||
| + | {{#set: consumed by=RXN-17830}} | ||
Revision as of 18:08, 18 March 2018
Contents
Metabolite CPD0-2500
- smiles:
- C(O)C2(C(O)C(O)C(O)C(OC1(C=CC(=CC=1)[N+]([O-])=O))O2)
- inchi key:
- InChIKey=IFBHRQDFSNCLOZ-IIRVCBMXSA-N
- common name:
- p-nitrophenyl-α-D-galactopyranoside
- molecular weight:
- 301.252
- Synonym(s):
- 4-nitrophenyl-α-D-galactopyranoside
- 4-nitrophenyl-α-D-galactoside
- p-nitrophenyl-α-D-galactoside
- pNPαGal
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C2(C(O)C(O)C(O)C(OC1(C=CC(=CC=1)[N+]([O-])=O))O2)" cannot be used as a page name in this wiki.
