Difference between revisions of "PWY-6269"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2107 CPD0-2107] == * smiles: ** CCCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)O...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASCORBATE ASCORBATE] == * smiles: ** C(O)C(O)[CH]1(C([O-])=C(O)C(=O)O1) * inchi key: ** InChIKe...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASCORBATE ASCORBATE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(O)C(O)[CH]1(C([O-])=C(O)C(=O)O1) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=CIWBSHSKHKDKBQ-JLAZNSOCSA-M |
* common name: | * common name: | ||
| − | ** | + | ** L-ascorbate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 175.118 |
* Synonym(s): | * Synonym(s): | ||
| + | ** L-ascorbic acid | ||
| + | ** ascorbate | ||
| + | ** vitamin C | ||
| + | ** ascorbic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-12440]] | ||
| + | * [[RXN-3521]] | ||
| + | * [[RXN-10981]] | ||
| + | * [[RXN-7984]] | ||
| + | * [[RXN-7985]] | ||
| + | * [[PEPTIDYLGLYCINE-MONOOXYGENASE-RXN]] | ||
| + | * [[RXN-12876]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-3523]] | ||
| + | * [[1.6.5.4-RXN]] | ||
| + | * [[RXN-12440]] | ||
| + | * [[GALACTONOLACTONE-DEHYDROGENASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[RXN-13185]] |
| − | + | ||
== External links == | == External links == | ||
| + | * CAS : 50-81-7 | ||
| + | * METABOLIGHTS : MTBLC38290 | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54679076 54679076] | ||
| + | * KNAPSACK : C00001179 | ||
| + | * HMDB : HMDB00044 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00072 C00072] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.102746.html 102746] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=38290 38290] |
| − | * BIGG : | + | * BIGG : ascb__L |
| − | + | {{#set: smiles=C(O)C(O)[CH]1(C([O-])=C(O)C(=O)O1)}} | |
| − | + | {{#set: inchi key=InChIKey=CIWBSHSKHKDKBQ-JLAZNSOCSA-M}} | |
| − | + | {{#set: common name=L-ascorbate}} | |
| − | {{#set: smiles= | + | {{#set: molecular weight=175.118 }} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: common name=L-ascorbic acid|ascorbate|vitamin C|ascorbic acid}} |
| − | {{#set: common name= | + | {{#set: consumed by=RXN-12440|RXN-3521|RXN-10981|RXN-7984|RXN-7985|PEPTIDYLGLYCINE-MONOOXYGENASE-RXN|RXN-12876}} |
| − | {{#set: molecular weight= | + | {{#set: produced by=RXN-3523|1.6.5.4-RXN|RXN-12440|GALACTONOLACTONE-DEHYDROGENASE-RXN}} |
| − | {{#set: consumed | + | {{#set: reversible reaction associated=RXN-13185}} |
Revision as of 18:16, 18 March 2018
Contents
Metabolite ASCORBATE
- smiles:
- C(O)C(O)[CH]1(C([O-])=C(O)C(=O)O1)
- inchi key:
- InChIKey=CIWBSHSKHKDKBQ-JLAZNSOCSA-M
- common name:
- L-ascorbate
- molecular weight:
- 175.118
- Synonym(s):
- L-ascorbic acid
- ascorbate
- vitamin C
- ascorbic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 50-81-7
- METABOLIGHTS : MTBLC38290
- PUBCHEM:
- KNAPSACK : C00001179
- HMDB : HMDB00044
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : ascb__L
"C(O)C(O)[CH]1(C([O-])=C(O)C(=O)O1)" cannot be used as a page name in this wiki.
