Difference between revisions of "RXN-17781"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CAMP CAMP] == * smiles: ** C1(OP(=O)([O-])OC2(C(O)C(OC12)N4(C=NC3(C(N)=NC=NC=34)))) * inchi key...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7726 PWY-7726] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7726 PWY-7726] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate biosynthesis (6-desaturase) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''5''' reactions found over '''13''' reactions in the full pathway |
− | * [[ | + | * [[RXN-16112]] |
− | + | ** 1 associated gene(s): | |
− | * [[ | + | *** [[Tiso_gene_9871]] |
− | * [[ | + | ** 2 reconstruction source(s) associated: |
− | == Reaction(s) | + | *** [[annotation-in-silico_annotation]] |
+ | *** [[annotation-experimental_annotation]] | ||
+ | * [[RXN-17109]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_9871]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | * [[RXN-17113]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_18566]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[RXN-17115]] | ||
+ | ** 0 associated gene: | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | * [[RXN-17116]] | ||
+ | ** 5 associated gene(s): | ||
+ | *** [[Tiso_gene_3856]] | ||
+ | *** [[Tiso_gene_17451]] | ||
+ | *** [[Tiso_gene_10116]] | ||
+ | *** [[Tiso_gene_3855]] | ||
+ | *** [[Tiso_gene_15327]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16079 RXN-16079] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16081 RXN-16081] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16113 RXN-16113] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16114 RXN-16114] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17110 RXN-17110] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17111 RXN-17111] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17112 RXN-17112] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17114 RXN-17114] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: common name=(4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate biosynthesis (6-desaturase)}} | |
− | + | {{#set: reaction found=5}} | |
− | + | {{#set: total reaction=13}} | |
− | + | {{#set: completion rate=38.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 18:18, 18 March 2018
Pathway PWY-7726
- taxonomic range:
- common name:
- (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate biosynthesis (6-desaturase)
- Synonym(s):
Reaction(s) found
5 reactions found over 13 reactions in the full pathway
- RXN-16112
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-17109
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-17113
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-17115
- 0 associated gene:
- 2 reconstruction source(s) associated:
- RXN-17116
- 5 associated gene(s):
- 2 reconstruction source(s) associated: