Difference between revisions of "PWY-6415"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALLYSINE ALLYSINE] == * smiles: ** [CH](=O)CCCC([N+])C(=O)[O-] * inchi key: ** InChIKey=GFXYTQP...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7626 PWY-7626] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7626 PWY-7626] == |
| − | * | + | * taxonomic range: |
| − | ** [ | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** bacilysin biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''10''' reactions in the full pathway |
| − | + | * [[CHORISMATEMUT-RXN]] | |
| − | * [[ | + | ** 1 associated gene(s): |
| − | == Reaction(s) | + | *** [[Tiso_gene_5940]] |
| − | * [[ | + | ** 5 reconstruction source(s) associated: |
| − | * [[RXN- | + | *** [[annotation-in-silico_annotation]] |
| + | *** [[orthology-athaliana]] | ||
| + | *** [[orthology-creinhardtii]] | ||
| + | *** [[manual-primary_network]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16263 RXN-16263] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16264 RXN-16264] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16265 RXN-16265] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16285 RXN-16285] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16296 RXN-16296] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16297 RXN-16297] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16298 RXN-16298] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16299 RXN-16299] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16300 RXN-16300] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=bacilysin biosynthesis}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=10}} | |
| − | + | {{#set: completion rate=10.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 18:20, 18 March 2018
Pathway PWY-7626
- taxonomic range:
- common name:
- bacilysin biosynthesis
- Synonym(s):
Reaction(s) found
1 reactions found over 10 reactions in the full pathway
- CHORISMATEMUT-RXN
- 1 associated gene(s):
- 5 reconstruction source(s) associated:
