Difference between revisions of "IMINOASPARTATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-68 CPD-68] == * smiles: ** C([O-])(=O)C1(CC1)[N+] * inchi key: ** InChIKey=PAJPWUMXBYXFCZ-U...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18301 RXN-18301] == * direction: ** LEFT-TO-RIGHT * common name: ** galactose-3-o-sulfotransfer...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-68 CPD-68] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18301 RXN-18301] ==
* smiles:
+
* direction:
** C([O-])(=O)C1(CC1)[N+]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=PAJPWUMXBYXFCZ-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** 1-aminocyclopropane-1-carboxylate
+
** galactose-3-o-sulfotransferase_2-like
* molecular weight:
+
* ec number:
** 101.105   
+
** [http://enzyme.expasy.org/EC/2.8.2.11 EC-2.8.2.11]
 
* Synonym(s):
 
* Synonym(s):
** 1-aminocyclopropane-1-carboxylic acid
 
** ACC
 
** 1-aminocyclopropanecarboxylic acid
 
** 1-aminocyclopropanecarboxylate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[4.1.99.4-RXN]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[A-GALACTOSYLCERAMIDE]][c] '''+''' 1 [[PAPS]][c] '''=>''' 1 [[galactosylceramide-sulfate]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[3-5-ADP]][c]
* [[4.4.1.14-RXN]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 a β-D-galactosyl-N-acylsphingosine[c] '''+''' 1 3'-phosphoadenylyl-sulfate[c] '''=>''' 1 a galactosylceramide sulfate[c] '''+''' 1 H+[c] '''+''' 1 adenosine 3',5'-bisphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_13030]]
 +
** IN-SILICO_ANNOTATION
 +
***EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7840]], gala-series glycosphingolipids biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7840 PWY-7840]
 +
** '''3''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* CAS : 22059-21-8
+
{{#set: direction=LEFT-TO-RIGHT}}
* PUBCHEM:
+
{{#set: common name=galactose-3-o-sulfotransferase_2-like}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971063 6971063]
+
{{#set: ec number=EC-2.8.2.11}}
* HMDB : HMDB36458
+
{{#set: gene associated=Tiso_gene_13030}}
* LIGAND-CPD:
+
{{#set: in pathway=PWY-7840}}
** [http://www.genome.jp/dbget-bin/www_bget?C01234 C01234]
+
{{#set: reconstruction category=annotation}}
* CHEBI:
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58360 58360]
+
{{#set: reconstruction tool=pathwaytools}}
* METABOLIGHTS : MTBLC58360
+
{{#set: smiles=C([O-])(=O)C1(CC1)[N+]}}
+
{{#set: inchi key=InChIKey=PAJPWUMXBYXFCZ-UHFFFAOYSA-N}}
+
{{#set: common name=1-aminocyclopropane-1-carboxylate}}
+
{{#set: molecular weight=101.105    }}
+
{{#set: common name=1-aminocyclopropane-1-carboxylic acid|ACC|1-aminocyclopropanecarboxylic acid|1-aminocyclopropanecarboxylate}}
+
{{#set: consumed by=4.1.99.4-RXN}}
+
{{#set: produced by=4.4.1.14-RXN}}
+

Revision as of 18:22, 18 March 2018

Reaction RXN-18301

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • galactose-3-o-sulfotransferase_2-like
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7840, gala-series glycosphingolipids biosynthesis: PWY-7840
    • 3 reactions found over 5 reactions in the full pathway

Reconstruction information

External links