Difference between revisions of "ARGASEDEG-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMINOASPARTATE IMINOASPARTATE] == * smiles: ** C(=O)([O-])CC(=N)C(=O)[O-] * inchi key: ** InChI...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5677 PWY-5677] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-12...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5677 PWY-5677] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** succinate fermentation to butanoate |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | == Reaction(s) | + | '''1''' reactions found over '''7''' reactions in the full pathway |
| − | * [[ | + | * [[4-HYDROXYBUTYRATE-DEHYDROGENASE-RXN]] |
| − | == | + | ** 2 associated gene(s): |
| + | *** [[Tiso_gene_91]] | ||
| + | *** [[Tiso_gene_777]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=BUTYRYL-COA-DEHYDROGENASE-RXN BUTYRYL-COA-DEHYDROGENASE-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=R11-RXN R11-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8807 RXN-8807] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8889 RXN-8889] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8890 RXN-8890] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8891 RXN-8891] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-1239}} | |
| − | + | {{#set: common name=succinate fermentation to butanoate}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=7}} | |
| − | + | {{#set: completion rate=14.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 18:22, 18 March 2018
Pathway PWY-5677
- taxonomic range:
- common name:
- succinate fermentation to butanoate
- Synonym(s):
Reaction(s) found
1 reactions found over 7 reactions in the full pathway
- 4-HYDROXYBUTYRATE-DEHYDROGENASE-RXN
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
