Difference between revisions of "RXN-15346"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLT D-GLT] == * smiles: ** C(CCC(C(=O)[O-])[N+])([O-])=O * inchi key: ** InChIKey=WHUUTDBJXJR...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=R-3-hydroxystearoyl-ACPs R-3-hydroxystearoyl-ACPs] == * common name: ** a (3R)-3-hydroxystearoy...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=R-3-hydroxystearoyl-ACPs R-3-hydroxystearoyl-ACPs] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a (3R)-3-hydroxystearoyl-[acp] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** a (R)-3-hydroxyoctadecnoyl-[acp] |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-9634]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-9633]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | + | {{#set: common name=a (3R)-3-hydroxystearoyl-[acp]}} | |
| − | + | {{#set: common name=a (R)-3-hydroxyoctadecnoyl-[acp]}} | |
| − | + | {{#set: consumed by=RXN-9634}} | |
| − | + | {{#set: produced by=RXN-9633}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
Revision as of 18:23, 18 March 2018
Contents
Metabolite R-3-hydroxystearoyl-ACPs
- common name:
- a (3R)-3-hydroxystearoyl-[acp]
- Synonym(s):
- a (R)-3-hydroxyoctadecnoyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a (3R)-3-hydroxystearoyl-[acp" cannot be used as a page name in this wiki.
"a (R)-3-hydroxyoctadecnoyl-[acp" cannot be used as a page name in this wiki.
