Difference between revisions of "Trans-D2-cis-cis-D5-17-C36-3-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUCROSE-6P SUCROSE-6P] == * smiles: ** C(OP(=O)([O-])[O-])C2(OC(CO)(OC1(OC(CO)C(O)C(O)C(O)1))C(...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Methylated-Ribosomal-Protein-L11s Methylated-Ribosomal-Protein-L11s] == * common name: ** a met...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUCROSE-6P SUCROSE-6P] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Methylated-Ribosomal-Protein-L11s Methylated-Ribosomal-Protein-L11s] ==
−
* smiles:
+
−
** C(OP(=O)([O-])[O-])C2(OC(CO)(OC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)2)
+
−
* inchi key:
+
−
** InChIKey=PJTTXANTBQDXME-UGDNZRGBSA-L
+
 
* common name:
 
* common name:
−
** sucrose 6F-phosphate
+
** a methylated ribosomal protein L11
−
* molecular weight:
+
−
** 420.263   
+
 
* Synonym(s):
 
* Synonym(s):
−
** sucrose-6F-P
 
−
** 6-O-phosphonato-β-D-fructofuranosyl α-D-glucopyranoside
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[BFFS]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[SUCROSE-PHOSPHATE-SYNTHASE-RXN]]
+
* [[RXN0-5419]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=a methylated ribosomal protein L11}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245080 25245080]
+
{{#set: produced by=RXN0-5419}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57723 57723]
+
−
* BIGG : suc6p
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C02591 C02591]
+
−
{{#set: smiles=C(OP(=O)([O-])[O-])C2(OC(CO)(OC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)2)}}
+
−
{{#set: inchi key=InChIKey=PJTTXANTBQDXME-UGDNZRGBSA-L}}
+
−
{{#set: common name=sucrose 6F-phosphate}}
+
−
{{#set: molecular weight=420.263    }}
+
−
{{#set: common name=sucrose-6F-P|6-O-phosphonato-β-D-fructofuranosyl α-D-glucopyranoside}}
+
−
{{#set: consumed by=BFFS}}
+
−
{{#set: produced by=SUCROSE-PHOSPHATE-SYNTHASE-RXN}}
+

Revision as of 18:23, 18 March 2018

Metabolite Methylated-Ribosomal-Protein-L11s

  • common name:
    • a methylated ribosomal protein L11
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Trans-D2-cis-cis-D5-17-C36-3-ACPs&oldid=24036"