Difference between revisions of "FE+2"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAP GAP] == * smiles: ** [CH](=O)C(O)COP(=O)([O-])[O-] * inchi key: ** InChIKey=LXJXRIRHZLFYRP-...") |
(Created page with "Category:Gene == Gene Tiso_gene_13794 == * left end position: ** 3441 * transcription direction: ** NEGATIVE * right end position: ** 4238 * centisome position: ** 56.7447...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_13794 == |
− | * | + | * left end position: |
− | ** | + | ** 3441 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 4238 |
− | * | + | * centisome position: |
− | ** | + | ** 56.744724 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[PEPTIDYLPROLYL-ISOMERASE-RXN]] |
− | + | ** in-silico_annotation | |
− | + | ***ec-number | |
− | * | + | ** experimental_annotation |
− | * | + | ***ec-number |
− | + | ** [[pantograph]]-[[esiliculosus]] | |
− | * | + | == Pathways associated == |
− | * | + | |
− | * | + | |
− | * | + | |
− | * | + | |
− | * | + | |
− | * | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3441}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=4238}} | |
− | + | {{#set: centisome position=56.744724 }} | |
− | + | {{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Revision as of 18:24, 18 March 2018
Gene Tiso_gene_13794
- left end position:
- 3441
- transcription direction:
- NEGATIVE
- right end position:
- 4238
- centisome position:
- 56.744724
- Synonym(s):
Reactions associated
- PEPTIDYLPROLYL-ISOMERASE-RXN
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation