Difference between revisions of "NARP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13792 CPD-13792] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)[O-] * inchi key: ** InChIK...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Glutamine-synthetase-adenylyl-Tyr Glutamine-synthetase-adenylyl-Tyr] == * common name: ** a [gl...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13792 CPD-13792] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Glutamine-synthetase-adenylyl-Tyr Glutamine-synthetase-adenylyl-Tyr] ==
* smiles:
+
** CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)[O-]
+
* inchi key:
+
** InChIKey=YUFFSWGQGVEMMI-JLNKQSITSA-M
+
 
* common name:
 
* common name:
** (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentenoate
+
** a [glutamine synthetase]-O4-(5'-adenylyl)-L-tyrosine
* molecular weight:
+
** 329.501   
+
 
* Synonym(s):
 
* Synonym(s):
** n-3 docosapentaenoic acid
 
** clupanodonic acid
 
** (7Z,10Z,13Z,16Z,19Z)-docosapentaenoate
 
** all-cis-7,10,13,16,19-docosapentaenoate
 
** (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoic acid
 
** n-3 docosapentaenoate
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13446]]
+
* [[GSADENYLATION-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMFA04000044
+
{{#set: common name=a [glutamine synthetase]-O4-(5'-adenylyl)-L-tyrosine}}
* PUBCHEM:
+
{{#set: produced by=GSADENYLATION-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=40846589 40846589]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77224 77224]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C16513 C16513]
+
* HMDB : HMDB06528
+
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)[O-]}}
+
{{#set: inchi key=InChIKey=YUFFSWGQGVEMMI-JLNKQSITSA-M}}
+
{{#set: common name=(7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentenoate}}
+
{{#set: molecular weight=329.501    }}
+
{{#set: common name=n-3 docosapentaenoic acid|clupanodonic acid|(7Z,10Z,13Z,16Z,19Z)-docosapentaenoate|all-cis-7,10,13,16,19-docosapentaenoate|(7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoic acid|n-3 docosapentaenoate}}
+
{{#set: produced by=RXN-13446}}
+

Revision as of 18:33, 18 March 2018

Metabolite Glutamine-synthetase-adenylyl-Tyr

  • common name:
    • a [glutamine synthetase]-O4-(5'-adenylyl)-L-tyrosine
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [glutamine synthetase]-O4-(5'-adenylyl)-L-tyrosine" cannot be used as a page name in this wiki.