Difference between revisions of "Tiso gene 8763"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-PARATHION AMINO-PARATHION] == * smiles: ** CCOP(OC1(C=CC(=CC=1)N))(OCC)=S * inchi key: **...") |
(Created page with "Category:Gene == Gene Tiso_gene_17192 == * left end position: ** 1000 * transcription direction: ** NEGATIVE * right end position: ** 3194 * centisome position: ** 25.9201...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_17192 == |
− | * | + | * left end position: |
− | ** | + | ** 1000 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 3194 |
− | * | + | * centisome position: |
− | ** | + | ** 25.920164 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[PYRIMSYN3-RXN]] |
− | + | ** in-silico_annotation | |
− | == | + | ***automated-name-match |
+ | == Pathways associated == | ||
+ | * [[PWY-6910]] | ||
+ | * [[PWY-7282]] | ||
+ | * [[PWY-6890]] | ||
+ | * [[PWY-7356]] | ||
+ | * [[PWY-7357]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1000}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=3194}} | |
− | + | {{#set: centisome position=25.920164 }} | |
− | + | {{#set: reaction associated=PYRIMSYN3-RXN}} | |
− | {{#set: | + | {{#set: pathway associated=PWY-6910|PWY-7282|PWY-6890|PWY-7356|PWY-7357}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 19:34, 18 March 2018
Gene Tiso_gene_17192
- left end position:
- 1000
- transcription direction:
- NEGATIVE
- right end position:
- 3194
- centisome position:
- 25.920164
- Synonym(s):
Reactions associated
- PYRIMSYN3-RXN
- in-silico_annotation
- automated-name-match
- in-silico_annotation