Difference between revisions of "Holo-VibB"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_4555 == * left end position: ** 9204 * transcription direction: ** POSITIVE * right end position: ** 10473 * centisome position: ** 62.4804...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8564 CPD-8564] == * smiles: ** C(O)C(C(=O)N[R])NC(=O)[R] * common name: ** myosin light-cha...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8564 CPD-8564] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(O)C(C(=O)N[R])NC(=O)[R] |
| − | * | + | * common name: |
| − | ** | + | ** myosin light-chain |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[2.7.11.18-RXN]] | |
| − | == | + | |
| − | * [[ | + | |
== External links == | == External links == | ||
| − | + | * LIGAND-CPD: | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01003 C01003] | |
| − | {{#set: | + | {{#set: smiles=C(O)C(C(=O)N[R])NC(=O)[R]}} |
| − | + | {{#set: common name=myosin light-chain}} | |
| − | {{#set: | + | {{#set: reversible reaction associated=2.7.11.18-RXN}} |
| − | {{#set: | + | |
Revision as of 18:37, 18 March 2018
Contents
Metabolite CPD-8564
- smiles:
- C(O)C(C(=O)N[R])NC(=O)[R]
- common name:
- myosin light-chain
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- LIGAND-CPD:
"C(O)C(C(=O)N[R])NC(=O)[R" cannot be used as a page name in this wiki.
