Difference between revisions of "Oxidized-flavodoxins"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_1773 == * left end position: ** 16660 * transcription direction: ** POSITIVE * right end position: ** 18855 * centisome position: ** 76.601...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRAZINOIC-ACID PYRAZINOIC-ACID] == * smiles: ** C1(N=CC=NC=1C([O-])=O) * inchi key: ** InChIKe...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRAZINOIC-ACID PYRAZINOIC-ACID] == |
| − | * | + | * smiles: |
| − | ** | + | ** C1(N=CC=NC=1C([O-])=O) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=NIPZZXUFJPQHNH-UHFFFAOYSA-M |
| − | * | + | * common name: |
| − | ** | + | ** pyrazine-2-carboxylate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 123.091 |
* Synonym(s): | * Synonym(s): | ||
| + | ** pyrazinoate | ||
| + | ** pyrazinoic acid | ||
| + | ** pyrazinecarboxylic acid | ||
| + | ** pyrazinemonocarboxylic acid | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[PYRAZIN-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3728869 3728869] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.2959374.html 2959374] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71266 71266] |
| + | * NCI: | ||
| + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=27192 27192] | ||
| + | {{#set: smiles=C1(N=CC=NC=1C([O-])=O)}} | ||
| + | {{#set: inchi key=InChIKey=NIPZZXUFJPQHNH-UHFFFAOYSA-M}} | ||
| + | {{#set: common name=pyrazine-2-carboxylate}} | ||
| + | {{#set: molecular weight=123.091 }} | ||
| + | {{#set: common name=pyrazinoate|pyrazinoic acid|pyrazinecarboxylic acid|pyrazinemonocarboxylic acid}} | ||
| + | {{#set: produced by=PYRAZIN-RXN}} | ||
Revision as of 18:45, 18 March 2018
Contents
Metabolite PYRAZINOIC-ACID
- smiles:
- C1(N=CC=NC=1C([O-])=O)
- inchi key:
- InChIKey=NIPZZXUFJPQHNH-UHFFFAOYSA-M
- common name:
- pyrazine-2-carboxylate
- molecular weight:
- 123.091
- Synonym(s):
- pyrazinoate
- pyrazinoic acid
- pyrazinecarboxylic acid
- pyrazinemonocarboxylic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(N=CC=NC=1C([O-])=O)" cannot be used as a page name in this wiki.
