Difference between revisions of "CPD-13010"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-67 CPD-67] == * smiles: ** C(OP([O-])(=O)[O-])C([O-])=O * inchi key: ** InChIKey=ASCFNMCAHF...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FORMAMIDE FORMAMIDE] == * smiles: ** C(N)=O * inchi key: ** InChIKey=ZHNUHDYFZUAESO-UHFFFAOYSA-...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FORMAMIDE FORMAMIDE] == |
* smiles: | * smiles: | ||
| − | ** C( | + | ** C(N)=O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=ZHNUHDYFZUAESO-UHFFFAOYSA-N |
* common name: | * common name: | ||
| − | ** | + | ** formamide |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 45.041 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** carbamaldehyde |
| − | ** | + | ** Methanamide |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[FORMAMIDASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | * | + | * CAS : 75-12-7 |
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=713 713] |
| − | * HMDB : | + | * HMDB : HMDB01536 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00488 C00488] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.693.html 693] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16397 16397] |
| − | + | {{#set: smiles=C(N)=O}} | |
| − | {{#set: smiles=C( | + | {{#set: inchi key=InChIKey=ZHNUHDYFZUAESO-UHFFFAOYSA-N}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: common name=formamide}} |
| − | {{#set: common name= | + | {{#set: molecular weight=45.041 }} |
| − | {{#set: molecular weight= | + | {{#set: common name=carbamaldehyde|Methanamide}} |
| − | {{#set: common name= | + | {{#set: consumed by=FORMAMIDASE-RXN}} |
| − | {{#set: consumed by= | + | |
Revision as of 18:45, 18 March 2018
Contents
Metabolite FORMAMIDE
- smiles:
- C(N)=O
- inchi key:
- InChIKey=ZHNUHDYFZUAESO-UHFFFAOYSA-N
- common name:
- formamide
- molecular weight:
- 45.041
- Synonym(s):
- carbamaldehyde
- Methanamide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
