Difference between revisions of "CPD-318"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15661 CPD-15661] == * smiles: ** CCCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R05068 R05068] == * direction: ** LEFT-TO-RIGHT * common name: ** R289 * Synonym(s): == Reaction F...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15661 CPD-15661] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=R05068 R05068] ==
* smiles:
+
* direction:
** CCCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=SZKPLUULGGERFD-MSNZEOPQSA-J
+
 
* common name:
 
* common name:
** 2-trans, 4-trans-undecadienoyl-CoA
+
** R289
* molecular weight:
+
** 927.749   
+
 
* Synonym(s):
 
* Synonym(s):
** 2E, 4E-undecadienoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-14789]]
+
** 1.0 [[NADPH]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[CPD-15104]][c] '''=>''' 1.0 [[1-KETO-2-METHYLVALERATE]][c] '''+''' 1.0 [[NADP]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 NADPH[c] '''+''' 1.0 H+[c] '''+''' 1.0 (R)-3-hydroxy-3-methyl-2-oxopentanoate[c] '''=>''' 1.0 (R)-2,3-dihydroxy-3-methylpentanoate[c] '''+''' 1.0 NADP+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_10174]]
 +
** [[pantograph]]-[[synechocystis]]
 +
* [[Tiso_gene_10173]]
 +
** [[pantograph]]-[[synechocystis]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-synechocystis]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658303 90658303]
+
{{#set: common name=R289}}
{{#set: smiles=CCCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: gene associated=Tiso_gene_10174|Tiso_gene_10173}}
{{#set: inchi key=InChIKey=SZKPLUULGGERFD-MSNZEOPQSA-J}}
+
{{#set: in pathway=}}
{{#set: common name=2-trans, 4-trans-undecadienoyl-CoA}}
+
{{#set: reconstruction category=orthology}}
{{#set: molecular weight=927.749    }}
+
{{#set: reconstruction source=orthology-synechocystis}}
{{#set: common name=2E, 4E-undecadienoyl-CoA}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: produced by=RXN-14789}}
+

Revision as of 18:46, 18 March 2018

Reaction R05068

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • R289
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 NADPH[c] + 1.0 H+[c] + 1.0 (R)-3-hydroxy-3-methyl-2-oxopentanoate[c] => 1.0 (R)-2,3-dihydroxy-3-methylpentanoate[c] + 1.0 NADP+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links