Difference between revisions of "Tiso gene 15757"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_9680 == * Synonym(s): == Reactions associated == * HYDROXYPYRROLINEDEH-RXN ** pantograph-synechocystis * PYRROLINECARBDEHYDR...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYLCHLOROPHYLLIDE-A DIVINYLCHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYLCHLOROPHYLLIDE-A DIVINYLCHLOROPHYLLIDE-A] == |
| + | * smiles: | ||
| + | ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9)))) | ||
| + | * common name: | ||
| + | ** 3,8-divinyl chlorophyllide a | ||
| + | * molecular weight: | ||
| + | ** 610.951 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-5286]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-5285]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * [[RXN- | + | |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=56927710 56927710] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.391650.html 391650] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=38259 38259] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C11832 C11832] | ||
| + | {{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}} | ||
| + | {{#set: common name=3,8-divinyl chlorophyllide a}} | ||
| + | {{#set: molecular weight=610.951 }} | ||
| + | {{#set: consumed by=RXN-5286}} | ||
| + | {{#set: produced by=RXN-5285}} | ||
Revision as of 18:46, 18 March 2018
Contents
Metabolite DIVINYLCHLOROPHYLLIDE-A
- smiles:
- C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
- common name:
- 3,8-divinyl chlorophyllide a
- molecular weight:
- 610.951
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.
