Difference between revisions of "Tiso gene 2932"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15691 CPD-15691] == * smiles: ** CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MMUM-RXN MMUM-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF * ec number: ** [http://e...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15691 CPD-15691] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=MMUM-RXN MMUM-RXN] ==
−
* smiles:
+
* direction:
−
** CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=VKLHSLOWDWGVGP-WOABMHMMSA-J
+
 
* common name:
 
* common name:
−
** 5-trans-3-oxo-dodecenoyl-CoA
+
** ORF
−
* molecular weight:
+
* ec number:
−
** 957.775   
+
** [http://enzyme.expasy.org/EC/2.1.1.10 EC-2.1.1.10]
 
* Synonym(s):
 
* Synonym(s):
−
** 5E-3-oxo-dodecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-14803]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[HOMO-CYS]][c] '''+''' 1 [[CPD-397]][c] '''=>''' 2 [[MET]][c] '''+''' 1 [[PROTON]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 L-homocysteine[c] '''+''' 1 S-methyl-L-methionine[c] '''=>''' 2 L-methionine[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_5515]]
 +
** IN-SILICO_ANNOTATION
 +
***EC-NUMBER
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[ADENOSYLHOMOCYSCAT-PWY]], L-methionine salvage from L-homocysteine: [http://metacyc.org/META/NEW-IMAGE?object=ADENOSYLHOMOCYSCAT-PWY ADENOSYLHOMOCYSCAT-PWY]
 +
** '''2''' reactions found over '''3''' reactions in the full pathway
 +
* [[PWY-702]], L-methionine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-702 PWY-702]
 +
** '''5''' reactions found over '''6''' reactions in the full pathway
 +
* [[PWY-5441]], S-methyl-L-methionine cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5441 PWY-5441]
 +
** '''1''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658857 90658857]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=26337 26337]
−
{{#set: smiles=CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: inchi key=InChIKey=VKLHSLOWDWGVGP-WOABMHMMSA-J}}
+
{{#set: common name=ORF}}
−
{{#set: common name=5-trans-3-oxo-dodecenoyl-CoA}}
+
{{#set: ec number=EC-2.1.1.10}}
−
{{#set: molecular weight=957.775    }}
+
{{#set: gene associated=Tiso_gene_5515}}
−
{{#set: common name=5E-3-oxo-dodecenoyl-CoA}}
+
{{#set: in pathway=ADENOSYLHOMOCYSCAT-PWY|PWY-702|PWY-5441}}
−
{{#set: consumed by=RXN-14803}}
+
{{#set: reconstruction category=orthology|annotation}}
 +
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Revision as of 19:47, 18 March 2018

Reaction MMUM-RXN

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 L-homocysteine[c] + 1 S-methyl-L-methionine[c] => 2 L-methionine[c] + 1 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_2932&oldid=26815"