Difference between revisions of "RXN-15137"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOYLCOA BENZOYLCOA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(=CC=CC=C1))COP(=O)(OP...")
(Created page with "Category:Gene == Gene Tiso_gene_608 == * left end position: ** 87 * transcription direction: ** POSITIVE * right end position: ** 243 * centisome position: ** 0.28049132...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOYLCOA BENZOYLCOA] ==
+
== Gene Tiso_gene_608 ==
* smiles:
+
* left end position:
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
** 87
* inchi key:
+
* transcription direction:
** InChIKey=VEVJTUNLALKRNO-TYHXJLICSA-J
+
** POSITIVE
* common name:
+
* right end position:
** benzoyl-CoA
+
** 243
* molecular weight:
+
* centisome position:
** 867.61    
+
** 0.28049132    
 
* Synonym(s):
 
* Synonym(s):
** S-benzoate coenzyme A
 
** benzoyl-S-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* [[3.1.26.3-RXN]]
* [[RXN-2006]]
+
** in-silico_annotation
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* CAS : 102185-37-5
+
{{#set: left end position=87}}
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266596 45266596]
+
{{#set: right end position=243}}
* CHEBI:
+
{{#set: centisome position=0.28049132   }}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57369 57369]
+
{{#set: reaction associated=3.1.26.3-RXN}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00512 C00512]
+
* HMDB : HMDB02252
+
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=VEVJTUNLALKRNO-TYHXJLICSA-J}}
+
{{#set: common name=benzoyl-CoA}}
+
{{#set: molecular weight=867.61   }}
+
{{#set: common name=S-benzoate coenzyme A|benzoyl-S-CoA}}
+
{{#set: produced by=RXN-2006}}
+

Revision as of 18:48, 18 March 2018

Gene Tiso_gene_608

  • left end position:
    • 87
  • transcription direction:
    • POSITIVE
  • right end position:
    • 243
  • centisome position:
    • 0.28049132
  • Synonym(s):

Reactions associated

Pathways associated

External links