|
|
| Line 1: |
Line 1: |
| − | [[Category:Metabolite]] | + | [[Category:Gene]] |
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12259 CPD-12259] == | + | == Gene Tiso_gene_8828 == |
| − | * smiles:
| + | |
| − | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCOP([O-])(=O)OP([O-])(=O)OC4(OC(CO)C(OC3(OC(CO)C(OC2(OC(CO)C(OC1(OC(CO)C(O)C(O)C(NC(=O)C)1))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CNC(CNC(CNC(CNC(C[N+])=O)=O)=O)=O)=O)C(NC(C)C(NC(C(=O)[O-])C)=O)=O)C(=O)N)C(NC(C)=O)2))C(O)C(NC(=O)C)3))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CNC(CNC(CNC(CNC(C[N+])=O)=O)=O)=O)=O)C(NC(C)C(NC(C(=O)[O-])C)=O)=O)C(=O)N)C(NC(C)=O)4))C)C)C)C)C)C
| + | |
| − | * inchi key:
| + | |
| − | ** InChIKey=YDLQGHNIONNLSM-SHGYSNKBSA-L
| + | |
| − | * common name:
| + | |
| − | ** a peptidoglycan dimer (S. aureus)
| + | |
| − | * molecular weight:
| + | |
| − | ** 3391.761
| + | |
| | * Synonym(s): | | * Synonym(s): |
| − | ** [N-acetylglucosamine-N-acetylmuramoyl-L-alanyl-D-glutamyl-L-lysyl-(Gly5)-D-alanyl-D-alanine]2 diphospho-undecaprenyl
| |
| | | | |
| − | == Reaction(s) known to consume the compound == | + | == Reactions associated == |
| − | * [[RXN-11065]] | + | * [[AMETt2h]] |
| − | == Reaction(s) known to produce the compound ==
| + | ** [[pantograph]]-[[creinhardtii]] |
| − | == Reaction(s) of unknown directionality == | + | * [[AMETt2m]] |
| | + | ** [[pantograph]]-[[creinhardtii]] |
| | + | == Pathways associated == |
| | == External links == | | == External links == |
| − | * PUBCHEM:
| + | {{#set: reaction associated=AMETt2h|AMETt2m}} |
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659087 90659087]
| + | |
| − | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCOP([O-])(=O)OP([O-])(=O)OC4(OC(CO)C(OC3(OC(CO)C(OC2(OC(CO)C(OC1(OC(CO)C(O)C(O)C(NC(=O)C)1))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CNC(CNC(CNC(CNC(C[N+])=O)=O)=O)=O)=O)C(NC(C)C(NC(C(=O)[O-])C)=O)=O)C(=O)N)C(NC(C)=O)2))C(O)C(NC(=O)C)3))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CNC(CNC(CNC(CNC(C[N+])=O)=O)=O)=O)=O)C(NC(C)C(NC(C(=O)[O-])C)=O)=O)C(=O)N)C(NC(C)=O)4))C)C)C)C)C)C}}
| + | |
| − | {{#set: inchi key=InChIKey=YDLQGHNIONNLSM-SHGYSNKBSA-L}}
| + | |
| − | {{#set: common name=a peptidoglycan dimer (S. aureus)}}
| + | |
| − | {{#set: molecular weight=3391.761 }}
| + | |
| − | {{#set: common name=[N-acetylglucosamine-N-acetylmuramoyl-L-alanyl-D-glutamyl-L-lysyl-(Gly5)-D-alanyl-D-alanine]2 diphospho-undecaprenyl}}
| + | |
| − | {{#set: consumed by=RXN-11065}} | + | |
