Difference between revisions of "Tiso gene 19293"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Histone-L-lysine Histone-L-lysine] == * common name: ** a [histone]-L-lysine * Synonym(s): ** h...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16618 CPD-16618] == * smiles: ** C(C(=O)[O-])C(O)[CH]=O * inchi key: ** InChIKey=QWHDXIUUXW...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Histone-L-lysine Histone-L-lysine] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16618 CPD-16618] ==
 +
* smiles:
 +
** C(C(=O)[O-])C(O)[CH]=O
 +
* inchi key:
 +
** InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M
 
* common name:
 
* common name:
** a [histone]-L-lysine
+
** L-malic semialdehyde
 +
* molecular weight:
 +
** 117.081   
 
* Synonym(s):
 
* Synonym(s):
** histone-L-lysine
+
** (3R)-3-hydroxy-4-oxobutanoate
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN]]
+
* [[RXN-6002]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[3.5.1.98-RXN]]
 
* [[HISTONE-ACETYLTRANSFERASE-RXN]]
 
 
== External links  ==
 
== External links  ==
{{#set: common name=a [histone]-L-lysine}}
+
* PUBCHEM:
{{#set: common name=histone-L-lysine}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658049 90658049]
{{#set: consumed by=HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN}}
+
{{#set: smiles=C(C(=O)[O-])C(O)[CH]=O}}
{{#set: consumed or produced by=3.5.1.98-RXN|HISTONE-ACETYLTRANSFERASE-RXN}}
+
{{#set: inchi key=InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M}}
 +
{{#set: common name=L-malic semialdehyde}}
 +
{{#set: molecular weight=117.081    }}
 +
{{#set: common name=(3R)-3-hydroxy-4-oxobutanoate}}
 +
{{#set: consumed by=RXN-6002}}

Revision as of 18:49, 18 March 2018

Metabolite CPD-16618

  • smiles:
    • C(C(=O)[O-])C(O)[CH]=O
  • inchi key:
    • InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M
  • common name:
    • L-malic semialdehyde
  • molecular weight:
    • 117.081
  • Synonym(s):
    • (3R)-3-hydroxy-4-oxobutanoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C(=O)[O-])C(O)[CH]=O" cannot be used as a page name in this wiki.