Difference between revisions of "Peptides-with-Leader-Sequence"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19492 CPD-19492] == * smiles: ** CCC(C([O-])=O)C(C(=O)[O-])=O * inchi key: ** InChIKey=OUGL...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19144 CPD-19144] == * smiles: ** CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19144 CPD-19144] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=MJWMOLDKMBISOB-YDGGZUKGSA-J |
* common name: | * common name: | ||
| − | ** | + | ** (7Z)-hexadecenoyl-CoA |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 999.899 |
* Synonym(s): | * Synonym(s): | ||
| + | ** cis-hexadec-7-enoyl-CoA | ||
| + | ** (7Z)-hexadec-7-enoyl-CoA | ||
| + | ** 16:1 cis-7 | ||
| + | ** 16:1(n-9) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-17779]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-17778]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | {{#set: smiles= | + | {{#set: smiles=CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=MJWMOLDKMBISOB-YDGGZUKGSA-J}} |
| − | {{#set: common name= | + | {{#set: common name=(7Z)-hexadecenoyl-CoA}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=999.899 }} |
| − | {{#set: consumed by=RXN- | + | {{#set: common name=cis-hexadec-7-enoyl-CoA|(7Z)-hexadec-7-enoyl-CoA|16:1 cis-7|16:1(n-9)}} |
| − | {{#set: | + | {{#set: consumed by=RXN-17779}} |
| + | {{#set: produced by=RXN-17778}} | ||
Revision as of 18:50, 18 March 2018
Contents
Metabolite CPD-19144
- smiles:
- CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=MJWMOLDKMBISOB-YDGGZUKGSA-J
- common name:
- (7Z)-hexadecenoyl-CoA
- molecular weight:
- 999.899
- Synonym(s):
- cis-hexadec-7-enoyl-CoA
- (7Z)-hexadec-7-enoyl-CoA
- 16:1 cis-7
- 16:1(n-9)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
