Difference between revisions of "N-terminal-N-Ac-L-cysteine"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Hexadecenoyl-ACPs 2-Hexadecenoyl-ACPs] == * common name: ** a trans hexadecenoyl-[acp] * Syno...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11409 CPD-11409] == * smiles: ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-]...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11409 CPD-11409] == |
+ | * smiles: | ||
+ | ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C(I)=C3)) | ||
+ | * inchi key: | ||
+ | ** InChIKey=GYORPZQLVMNOGY-RUPWJETCSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** tetraiodothyroacetate ether glucuronide |
+ | * molecular weight: | ||
+ | ** 921.943 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** tetraiodothyroacetic acid ether glucuronide |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-10616]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659237 90659237] |
− | {{#set: | + | {{#set: smiles=C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C(I)=C3))}} |
− | {{#set: produced by= | + | {{#set: inchi key=InChIKey=GYORPZQLVMNOGY-RUPWJETCSA-L}} |
+ | {{#set: common name=tetraiodothyroacetate ether glucuronide}} | ||
+ | {{#set: molecular weight=921.943 }} | ||
+ | {{#set: common name=tetraiodothyroacetic acid ether glucuronide}} | ||
+ | {{#set: produced by=RXN-10616}} |
Revision as of 19:52, 18 March 2018
Contents
Metabolite CPD-11409
- smiles:
- C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C(I)=C3))
- inchi key:
- InChIKey=GYORPZQLVMNOGY-RUPWJETCSA-L
- common name:
- tetraiodothyroacetate ether glucuronide
- molecular weight:
- 921.943
- Synonym(s):
- tetraiodothyroacetic acid ether glucuronide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C(I)=C3))" cannot be used as a page name in this wiki.