Difference between revisions of "FACOAL18111Z"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11409 CPD-11409] == * smiles: ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-]...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13684 RXN-13684] == * direction: ** REVERSIBLE * common name: ** acy1-like_metalloprotease * ec...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11409 CPD-11409] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13684 RXN-13684] ==
* smiles:
+
* direction:
** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C(I)=C3))
+
** REVERSIBLE
* inchi key:
+
** InChIKey=GYORPZQLVMNOGY-RUPWJETCSA-L
+
 
* common name:
 
* common name:
** tetraiodothyroacetate ether glucuronide
+
** acy1-like_metalloprotease
* molecular weight:
+
* ec number:
** 921.943   
+
** [http://enzyme.expasy.org/EC/3.5.1.14 EC-3.5.1.14]
 +
** [http://enzyme.expasy.org/EC/3.5.1.114 EC-3.5.1.114]
 
* Synonym(s):
 
* Synonym(s):
** tetraiodothyroacetic acid ether glucuronide
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-10616]]
+
** 1 [[Mercapturates]][c] '''+''' 1 [[WATER]][c] '''<=>''' 1 [[S-Substituted-L-Cysteines]][c] '''+''' 1 [[ACET]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a mercapturate[c] '''+''' 1 H2O[c] '''<=>''' 1 an L-cysteine-S-conjugate[c] '''+''' 1 acetate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_16879]]
 +
** IN-SILICO_ANNOTATION
 +
***EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659237 90659237]
+
{{#set: common name=acy1-like_metalloprotease}}
{{#set: smiles=C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C(I)=C3))}}
+
{{#set: ec number=EC-3.5.1.14}}
{{#set: inchi key=InChIKey=GYORPZQLVMNOGY-RUPWJETCSA-L}}
+
{{#set: ec number=EC-3.5.1.114}}
{{#set: common name=tetraiodothyroacetate ether glucuronide}}
+
{{#set: gene associated=Tiso_gene_16879}}
{{#set: molecular weight=921.943    }}
+
{{#set: in pathway=}}
{{#set: common name=tetraiodothyroacetic acid ether glucuronide}}
+
{{#set: reconstruction category=annotation}}
{{#set: produced by=RXN-10616}}
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}

Revision as of 18:52, 18 March 2018

Reaction RXN-13684

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links