Difference between revisions of "Tiso gene 3392"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-725 CPD-725] == * smiles: ** CCC=CCC(C=CC=CCCCCCCCC([O-])=O)OO * inchi key: ** InChIKey=UYQ...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-Glutaminyl-Peptides L-Glutaminyl-Peptides] == * common name: ** an N-terminal L-glutaminyl-[p...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-Glutaminyl-Peptides L-Glutaminyl-Peptides] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** an N-terminal L-glutaminyl-[protein] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** a [protein] N-terminal L-glutamine |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-17893]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=an N-terminal L-glutaminyl-[protein]}} | |
| − | + | {{#set: common name=a [protein] N-terminal L-glutamine}} | |
| − | + | {{#set: produced by=RXN-17893}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | {{#set: produced by=RXN- | + | |
Revision as of 18:54, 18 March 2018
Contents
Metabolite L-Glutaminyl-Peptides
- common name:
- an N-terminal L-glutaminyl-[protein]
- Synonym(s):
- a [protein] N-terminal L-glutamine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"an N-terminal L-glutaminyl-[protein" cannot be used as a page name in this wiki.
"a [protein] N-terminal L-glutamine" cannot be used as a page name in this wiki.
