Difference between revisions of "RXN-11598"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-N2-Methylguanine-26 tRNA-Containing-N2-Methylguanine-26] == * common name: ** a...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11412 CPD-11412] == * smiles: ** C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(C=C(I)C(=C(I)C=2...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-N2-Methylguanine-26 tRNA-Containing-N2-Methylguanine-26] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11412 CPD-11412] ==
 +
* smiles:
 +
** C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(C=C(I)C(=C(I)C=2)OC3(=CC(I)=C(O)C=C3))
 +
* inchi key:
 +
** InChIKey=FPEJNMNXCSITJO-KFYUBCHVSA-M
 
* common name:
 
* common name:
** an N2-methylguanine26 in tRNA
+
** triiodothyroacetate ester glucuronide
 +
* molecular weight:
 +
** 797.054   
 
* Synonym(s):
 
* Synonym(s):
 +
** triiodothyroacetic acid ester glucuronide
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12376]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12375]]
+
* [[RXN-10618]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=an N2-methylguanine26 in tRNA}}
+
* PUBCHEM:
{{#set: consumed by=RXN-12376}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659348 90659348]
{{#set: produced by=RXN-12375}}
+
{{#set: smiles=C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(C=C(I)C(=C(I)C=2)OC3(=CC(I)=C(O)C=C3))}}
 +
{{#set: inchi key=InChIKey=FPEJNMNXCSITJO-KFYUBCHVSA-M}}
 +
{{#set: common name=triiodothyroacetate ester glucuronide}}
 +
{{#set: molecular weight=797.054    }}
 +
{{#set: common name=triiodothyroacetic acid ester glucuronide}}
 +
{{#set: produced by=RXN-10618}}

Revision as of 18:55, 18 March 2018

Metabolite CPD-11412

  • smiles:
    • C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(C=C(I)C(=C(I)C=2)OC3(=CC(I)=C(O)C=C3))
  • inchi key:
    • InChIKey=FPEJNMNXCSITJO-KFYUBCHVSA-M
  • common name:
    • triiodothyroacetate ester glucuronide
  • molecular weight:
    • 797.054
  • Synonym(s):
    • triiodothyroacetic acid ester glucuronide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OC1(C(O)C(O)C(O)C(C(=O)[O-])O1))(=O)CC2(C=C(I)C(=C(I)C=2)OC3(=CC(I)=C(O)C=C3))" cannot be used as a page name in this wiki.