Difference between revisions of "PYAMPP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-882 RXN0-882] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12852 CPD-12852] == * smiles: ** CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CC...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-882 RXN0-882] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12852 CPD-12852] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.17.7.1 EC-1.17.7.1]
+
** InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N
 +
* common name:
 +
** 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol
 +
* molecular weight:
 +
** 412.698   
 
* Synonym(s):
 
* Synonym(s):
 +
** 5α-cholesta-8,24-dien-3β-ol
 +
** 4α,14α-dimethylzymosterol
 +
** 29-norlanosterol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-11881]]
−
** 2 [[Reduced-ferredoxins]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE]][c] '''=>''' 2 [[Oxidized-ferredoxins]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[HYDROXY-METHYL-BUTENYL-DIP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 2 a reduced ferredoxin [iron-sulfur] cluster[c] '''+''' 1 H+[c] '''+''' 1 2-C-methyl-D-erythritol-2,4-cyclodiphosphate[c] '''=>''' 2 an oxidized ferredoxin [iron-sulfur] cluster[c] '''+''' 1 H2O[c] '''+''' 1 (E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_15758]]
+
−
** [[pantograph]]-[[synechocystis]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-7560]], methylerythritol phosphate pathway II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7560 PWY-7560]
+
−
** '''9''' reactions found over '''9''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[synechocystis]]
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R08689 R08689]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15101557 15101557]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}}
−
{{#set: ec number=EC-1.17.7.1}}
+
{{#set: inchi key=InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N}}
−
{{#set: gene associated=Tiso_gene_15758}}
+
{{#set: common name=4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol}}
−
{{#set: in pathway=PWY-7560}}
+
{{#set: molecular weight=412.698    }}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=5α-cholesta-8,24-dien-3β-ol|4α,14α-dimethylzymosterol|29-norlanosterol}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: consumed by=RXN-11881}}
−
{{#set: reconstruction source=synechocystis|esiliculosus}}
+

Revision as of 18:56, 18 March 2018

Metabolite CPD-12852

  • smiles:
    • CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
  • inchi key:
    • InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N
  • common name:
    • 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol
  • molecular weight:
    • 412.698
  • Synonym(s):
    • 5α-cholesta-8,24-dien-3β-ol
    • 4α,14α-dimethylzymosterol
    • 29-norlanosterol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PYAMPP&oldid=27909"