Difference between revisions of "CPD0-1812"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7666 RXN-7666] == * direction: ** LEFT-TO-RIGHT * common name: ** geranylgeranyl_diphosphate_re...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14950 CPD-14950] == * smiles: ** COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3)) * i...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7666 RXN-7666] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14950 CPD-14950] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3))
 +
* inchi key:
 +
** InChIKey=VJJZJBUCDWKPLC-UHFFFAOYSA-N
 
* common name:
 
* common name:
−
** geranylgeranyl_diphosphate_reductase
+
** 3-O-methylkaempferol
 +
* molecular weight:
 +
** 300.267   
 
* Synonym(s):
 
* Synonym(s):
 +
** kaempferol 3-methyl ether
 +
** 3-Methoxyapigenin
 +
** isokaempferide
 +
** 3-methylkaempferol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[CPD-7006]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[CHLOROPHYLL-A]][c]
+
* [[RXN-13935]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H+[c] '''+''' 1 NADPH[c] '''+''' 1 tetrahydrogeranylgeranyl chlorophyll a[c] '''=>''' 1 NADP+[c] '''+''' 1 chlorophyll a[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_2613]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
** EXPERIMENTAL_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY-5064]], chlorophyll a biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5064 PWY-5064]
+
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=geranylgeranyl_diphosphate_reductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280862 5280862]
−
{{#set: gene associated=Tiso_gene_2613}}
+
* CHEBI:
−
{{#set: in pathway=PWY-5064}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1579 1579]
−
{{#set: reconstruction category=annotation}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pathwaytools}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05902 C05902]
−
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+
{{#set: smiles=COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3))}}
 +
{{#set: inchi key=InChIKey=VJJZJBUCDWKPLC-UHFFFAOYSA-N}}
 +
{{#set: common name=3-O-methylkaempferol}}
 +
{{#set: molecular weight=300.267    }}
 +
{{#set: common name=kaempferol 3-methyl ether|3-Methoxyapigenin|isokaempferide|3-methylkaempferol}}
 +
{{#set: produced by=RXN-13935}}

Revision as of 18:58, 18 March 2018

Metabolite CPD-14950

  • smiles:
    • COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3))
  • inchi key:
    • InChIKey=VJJZJBUCDWKPLC-UHFFFAOYSA-N
  • common name:
    • 3-O-methylkaempferol
  • molecular weight:
    • 300.267
  • Synonym(s):
    • kaempferol 3-methyl ether
    • 3-Methoxyapigenin
    • isokaempferide
    • 3-methylkaempferol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD0-1812&oldid=28040"