Difference between revisions of "4-CYTIDINE-5-DIPHOSPHO-2-C"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14481 RXN-14481] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEAMIDO-NAD DEAMIDO-NAD] == * smiles: ** C1(C(=CC=C[N+]=1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEAMIDO-NAD DEAMIDO-NAD] == |
− | * | + | * smiles: |
− | ** | + | ** C1(C(=CC=C[N+]=1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C([O-])=O) |
+ | * inchi key: | ||
+ | ** InChIKey=SENPVEZBRZQVST-HISDBWNOSA-L | ||
+ | * common name: | ||
+ | ** nicotinate adenine dinucleotide | ||
+ | * molecular weight: | ||
+ | ** 662.399 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** Deamino-NAD+ | ||
+ | ** NaADN | ||
+ | ** deamido-NAD+ | ||
+ | ** deamidonicotinamide adenine dinucleoetide | ||
+ | ** deamido-NAD | ||
+ | ** NAAD | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[DNNH]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[NICONUCADENYLYLTRAN-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 6450-77-7 |
− | {{#set: | + | * DRUGBANK : DB04099 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266646 45266646] |
− | {{#set: | + | * HMDB : HMDB01179 |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00857 C00857] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58437 58437] | ||
+ | * BIGG : dnad | ||
+ | {{#set: smiles=C1(C(=CC=C[N+]=1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C([O-])=O)}} | ||
+ | {{#set: inchi key=InChIKey=SENPVEZBRZQVST-HISDBWNOSA-L}} | ||
+ | {{#set: common name=nicotinate adenine dinucleotide}} | ||
+ | {{#set: molecular weight=662.399 }} | ||
+ | {{#set: common name=Deamino-NAD+|NaADN|deamido-NAD+|deamidonicotinamide adenine dinucleoetide|deamido-NAD|NAAD}} | ||
+ | {{#set: consumed by=DNNH}} | ||
+ | {{#set: produced by=NICONUCADENYLYLTRAN-RXN}} |
Revision as of 19:00, 18 March 2018
Contents
Metabolite DEAMIDO-NAD
- smiles:
- C1(C(=CC=C[N+]=1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C([O-])=O)
- inchi key:
- InChIKey=SENPVEZBRZQVST-HISDBWNOSA-L
- common name:
- nicotinate adenine dinucleotide
- molecular weight:
- 662.399
- Synonym(s):
- Deamino-NAD+
- NaADN
- deamido-NAD+
- deamidonicotinamide adenine dinucleoetide
- deamido-NAD
- NAAD
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 6450-77-7
- DRUGBANK : DB04099
- PUBCHEM:
- HMDB : HMDB01179
- LIGAND-CPD:
- CHEBI:
- BIGG : dnad
"C1(C(=CC=C[N+]=1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C([O-])=O)" cannot be used as a page name in this wiki.