Difference between revisions of "RXN66-181"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-MYO-INOSITOL-4-PHOSPHATE D-MYO-INOSITOL-4-PHOSPHATE] == * smiles: ** C1(O)(C(O)C(O)C(OP(=O)([...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5260 RXN0-5260] == * direction: ** LEFT-TO-RIGHT * common name: ** sn-glycerol 3-phosphate:ubi...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-MYO-INOSITOL-4-PHOSPHATE D-MYO-INOSITOL-4-PHOSPHATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5260 RXN0-5260] ==
−
* smiles:
+
* direction:
−
** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=INAPMGSXUVUWAF-CNWJWELYSA-L
+
 
* common name:
 
* common name:
−
** 1D-myo-inositol 4-monophosphate
+
** sn-glycerol 3-phosphate:ubiquinone oxidoreductase
−
* molecular weight:
+
* ec number:
−
** 258.121   
+
** [http://enzyme.expasy.org/EC/1.1.5.3 EC-1.1.5.3]
 
* Synonym(s):
 
* Synonym(s):
−
** D-myo-inositol 4-phosphate
 
−
** D-myo-inositol 4-monophosphate
 
−
** inositol 4-phosphate
 
−
** Ins(4)P1
 
−
** Ins(4)P
 
−
** Ins4P
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-10952]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[GLYCEROL-3P]][c] '''+''' 1 [[Ubiquinones]][c] '''=>''' 1 [[Ubiquinols]][c] '''+''' 1 [[DIHYDROXY-ACETONE-PHOSPHATE]][c]
−
* [[3.1.3.57-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 sn-glycerol 3-phosphate[c] '''+''' 1 a ubiquinone[c] '''=>''' 1 an ubiquinol[c] '''+''' 1 glycerone phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_15777]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY0-1561]], glycerol-3-phosphate to cytochrome bo oxidase electron transfer: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1561 PWY0-1561]
 +
** '''1''' reactions found over '''2''' reactions in the full pathway
 +
* [[PWY0-1584]], nitrate reduction X (dissimilatory, periplasmic): [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1584 PWY0-1584]
 +
** '''1''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 46495-39-0
+
* RHEA:
−
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=28755 28755]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200523 25200523]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18977 18977]
−
* HMDB : HMDB01313
+
* LIGAND-RXN:
−
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?R00849 R00849]
−
** [http://www.genome.jp/dbget-bin/www_bget?C03546 C03546]
+
** [http://www.genome.jp/dbget-bin/www_bget?R08657 R08657]
−
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58469 58469]
+
{{#set: common name=sn-glycerol 3-phosphate:ubiquinone oxidoreductase}}
−
* METABOLIGHTS : MTBLC58469
+
{{#set: ec number=EC-1.1.5.3}}
−
{{#set: smiles=C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)}}
+
{{#set: gene associated=Tiso_gene_15777}}
−
{{#set: inchi key=InChIKey=INAPMGSXUVUWAF-CNWJWELYSA-L}}
+
{{#set: in pathway=PWY0-1561|PWY0-1584}}
−
{{#set: common name=1D-myo-inositol 4-monophosphate}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: molecular weight=258.121    }}
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
{{#set: common name=D-myo-inositol 4-phosphate|D-myo-inositol 4-monophosphate|inositol 4-phosphate|Ins(4)P1|Ins(4)P|Ins4P}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: consumed by=RXN-10952}}
+
−
{{#set: produced by=3.1.3.57-RXN}}
+

Revision as of 00:07, 19 March 2018

Reaction RXN0-5260

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • sn-glycerol 3-phosphate:ubiquinone oxidoreductase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY0-1561, glycerol-3-phosphate to cytochrome bo oxidase electron transfer: PWY0-1561
    • 1 reactions found over 2 reactions in the full pathway
  • PWY0-1584, nitrate reduction X (dissimilatory, periplasmic): PWY0-1584
    • 1 reactions found over 2 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN66-181&oldid=28823"